|
|
| | DIIODOTRIPHENYLPHOSPHORANE Basic information |
| Product Name: | DIIODOTRIPHENYLPHOSPHORANE | | Synonyms: | DIIDOTRIPHENYLPHOSPHORANE;DIIODOTRIPHENYLPHOSPHORANE;TRIPHENYLPHOSPHINE DIIODIDE;diiodotriphenyl-phosphoran;iodotriphenylphosphoraniumiodide;DIIODOTRIPHENYLPHOSPHORANE, TECH., 90%;Triphenyldiiodophosphorane;diiodo(triphenyl)-$l^{5}-phosphane | | CAS: | 6396-07-2 | | MF: | C18H15I2P | | MW: | 516.09 | | EINECS: | | | Product Categories: | | | Mol File: | 6396-07-2.mol |  |
| | DIIODOTRIPHENYLPHOSPHORANE Chemical Properties |
| Melting point | 210-220 °C (lit.) | | storage temp. | 2-8°C | | form | Powder | | color | Yellow to orange | | Sensitive | Light Sensitive | | InChI | 1S/C18H15I2P/c19-21(20,16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H | | InChIKey | NSWZEXJQHIXCFL-UHFFFAOYSA-N | | SMILES | IP(I)(c1ccccc1)(c2ccccc2)c3ccccc3 | | CAS DataBase Reference | 6396-07-2 |
| Hazard Codes | C | | Risk Statements | 34-42/43-62 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2923 8/PG 2 | | WGK Germany | 3 | | RTECS | TB6100000 | | F | 8-10 | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Repr. 2
Resp. Sens. 1
Skin Corr. 1B
Skin Sens. 1 |
| | DIIODOTRIPHENYLPHOSPHORANE Usage And Synthesis |
| Uses | Triphenylphosphine diiodide (Ph3P. I2) can be used as a reagent:
- To facilitate the conversion of alcohol, thiol, and enol functional groups into alkyl iodides via formation of alkoxyphosphonium iodide.
- To prepare β-iodo-α,β-unsaturated ketones from cyclic β-diketones in the presence of triethyl amine.
- In the synthesis of alkyl nitrates from alcohols.
- In the Beckmann rearrangement reaction to synthesize lactams from cycloalkanone oxime.
- For the preparation of aromatic and aliphatic carboxylic acid esters in the presence of N,N-dimethylaminopyridine.
Ph3P. I2 can also be used to reduce graphene oxide for the production of graphene nanosheets under mild and environmentally friendly conditions. |
| | DIIODOTRIPHENYLPHOSPHORANE Preparation Products And Raw materials |
|