| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:6-(Thiophen-2-yl)-1,3,5-triazine-2,4-diamine
CAS:35841-87-3
Purity:6-(Thiophen-2-yl)-1,3,5-triazine-2,4-diamine Package:1G Remarks:JRD1397-1G
|
| Company Name: |
Birdo (Shanghai) Medical Technology Co., Ltd.
|
| Tel: |
021-58099077-8041 18601625411 |
| Email: |
sales@birdotech.com |
| Products Intro: |
Product Name:6-(thiophen-2-yl)-1,3,5-triazine-2,4-diamine
CAS:35841-87-3
Purity:98% Package:5g;10g Remarks:AC650600
|
| Company Name: |
Taizhou Nanfeng Pharmaceutical Research Institute
|
| Tel: |
nanfengdrug@163.com; 18616377689 |
| Email: |
nanfengdrug@163.com |
| Products Intro: |
Product Name:6-(THIOPHEN-2-YL)-1,3,5-TRIAZINE-2,4-DIAMINE
CAS:35841-87-3
Purity:98%+ Package:10g;100g;1kg;10kg;100kg
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:6-(Thiophen-2-yl)-1,3,5-triazine-2,4-diamine
CAS:35841-87-3
|
| Company Name: |
Heterocyclics Inc
|
| Tel: |
732-444-6336 |
| Email: |
info@heterocyclics.com |
| Products Intro: |
Product Name:JR-6717, 6-(Thiophen-2-yl)-1,3,5-triazine-2,4-diamine, 97%
CAS:35841-87-3
|
|
| | 6-(THIOPHEN-2-YL)-1,3,5-TRIAZINE-2,4-DIAMINE Basic information |
| Product Name: | 6-(THIOPHEN-2-YL)-1,3,5-TRIAZINE-2,4-DIAMINE | | Synonyms: | JR-6717, 6-(Thiophen-2-yl)-1,3,5-triazine-2,4-diamine, 97%;6-(THIOPHEN-2-YL)-1,3,5-TRIAZINE-2,4-DIAMINE;1,3,5-Triazine-2,4-diamine, 6-(2-thienyl)- | | CAS: | 35841-87-3 | | MF: | C7H7N5S | | MW: | 193.23 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | 6-(THIOPHEN-2-YL)-1,3,5-TRIAZINE-2,4-DIAMINE Chemical Properties |
| Melting point | 245-247 °C | | Boiling point | 527.0±42.0 °C(Predicted) | | density | 1.504±0.06 g/cm3(Predicted) | | form | solid | | pka | 4.27±0.10(Predicted) | | InChI | 1S/C7H7N5S/c8-6-10-5(11-7(9)12-6)4-2-1-3-13-4/h1-3H,(H4,8,9,10,11,12) | | InChIKey | ATTKZMCIEMDLPY-UHFFFAOYSA-N | | SMILES | N=C(N1)N=C(NC1=N)C2=CC=CS2 |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 6-(THIOPHEN-2-YL)-1,3,5-TRIAZINE-2,4-DIAMINE Usage And Synthesis |
| | 6-(THIOPHEN-2-YL)-1,3,5-TRIAZINE-2,4-DIAMINE Preparation Products And Raw materials |
|