|
|
| | Methyl 2-amino-4-methylthiazole-5-carboxylate Basic information | | Uses |
| Product Name: | Methyl 2-amino-4-methylthiazole-5-carboxylate | | Synonyms: | 2-AMINO-4-METHYL-THIAZOLE-5-CARBOXYLIC ACID METHYL ESTER;METHYL 2-AMINO-4-METHYL-1,3-THIAZOLE-5-CARBOXYLATE;METHYL 2-AMINO-4-METHYLTHIAZOLE-5-CARBOXYLATE;CHEMBRDG-BB 4142897;BUTTPARK 76\07-67;ART-CHEM-BB B000344;AKOS B000344;2-Amino-4-methylthiazole-5-methyl formate | | CAS: | 3829-80-9 | | MF: | C6H8N2O2S | | MW: | 172.2 | | EINECS: | 672-079-5 | | Product Categories: | | | Mol File: | 3829-80-9.mol |  |
| | Methyl 2-amino-4-methylthiazole-5-carboxylate Chemical Properties |
| Melting point | 171-174 °C | | Boiling point | 301.3±22.0 °C(Predicted) | | density | 1.339±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, protect from light | | form | solid | | pka | 3.83±0.10(Predicted) | | color | Yellow | | InChI | InChI=1S/C6H8N2O2S/c1-3-4(5(9)10-2)11-6(7)8-3/h1-2H3,(H2,7,8) | | InChIKey | TYUGYIMCRDPMPJ-UHFFFAOYSA-N | | SMILES | S1C(C(OC)=O)=C(C)N=C1N | | CAS DataBase Reference | 3829-80-9(CAS DataBase Reference) |
| Hazard Codes | Xi | | HazardClass | IRRITANT | | HS Code | 2934100090 |
| | Methyl 2-amino-4-methylthiazole-5-carboxylate Usage And Synthesis |
| Uses | Methyl 2-amino-4-methylthiazole-5-carboxylate is a useful research chemical. | | Chemical Properties | white crysta | | Synthesis | GENERAL METHODS: A mixture of methyl acetoacetate (0.5 mmol), thiourea (0.5 mmol), iodine (0.5 mmol), DMSO (2 mL), and MMT-K10 (20 mg) was reacted at 80 °C with stirring. The reaction progress was monitored by TLC (unfolding agent: petroleum ether/ethyl acetate, 4:1). Upon completion of the reaction, the catalyst was separated by filtration and the solvent was subsequently removed under reduced pressure. The crude product was dissolved in hot water and extracted with ether (3 x 30 mL), and the pH of the aqueous phase was adjusted to 9-10 with ammonia to precipitate the solid product. Finally, the resulting precipitate was recrystallized from ethanol to give methyl 2-amino-4-methylthiazole-5-carboxylate. | | References | [1] RSC Advances, 2016, vol. 6, # 69, p. 64749 - 64755
[2] Research on Chemical Intermediates, 2016, vol. 42, # 12, p. 8175 - 8183
[3] Advanced Synthesis and Catalysis, 2018, vol. 360, # 8, p. 1584 - 1589
[4] Monatshefte fur Chemie, 2017, vol. 148, # 4, p. 745 - 749
[5] Journal of Molecular Structure, 2017, vol. 1144, p. 58 - 65 |
| | Methyl 2-amino-4-methylthiazole-5-carboxylate Preparation Products And Raw materials |
|