|
|
| | 4-BROMO METHYLBENZYL ALCOHOL Basic information |
| | 4-BROMO METHYLBENZYL ALCOHOL Chemical Properties |
| Melting point | 76-77℃ | | Boiling point | 287.9±20.0 °C(Predicted) | | density | 1.514±0.06 g/cm3 (20 ºC 760 Torr) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | solid | | pka | 14.26±0.10(Predicted) | | color | Off-white | | InChI | InChI=1S/C8H9BrO/c9-5-7-1-3-8(6-10)4-2-7/h1-4,10H,5-6H2 | | InChIKey | RDHSYXFAOVTAEH-UHFFFAOYSA-N | | SMILES | C1(CO)=CC=C(CBr)C=C1 |
| RIDADR | 2811 | | HazardClass | 6.1 | | PackingGroup | Ⅱ | | HS Code | 2906290090 |
| | 4-BROMO METHYLBENZYL ALCOHOL Usage And Synthesis |
| Synthesis | The general procedure for the synthesis of 4-bromomethylbenzyl alcohol from methyl 4-bromomethylbenzoate was as follows: under nitrogen protection, methyl 4-bromomethylbenzoate (5.73 g, 25 mmol) was dissolved in anhydrous CH2Cl2 (150 mL), stirred and cooled to -78 °C. DIBAL-H solution (82.5 mL, 1.0 M THF solution) was added slowly and dropwise. The -78 °C reaction temperature was maintained and stirring was continued for 1.5 hours. Subsequently, the reaction mixture was slowly warmed to 0 °C and the reaction was quenched with H2O. The organic layer was separated and the aqueous layer was extracted with CH2Cl2 (2 x 100 mL). The organic extracts were combined, dried with MgSO4 and the solvent was evaporated under reduced pressure to afford the target product 4-bromomethylbenzyl alcohol (5.0 g, 100% yield) as a white solid. The product was characterized by 1H NMR (CDCl3): δ1.84 (br, 1H), 4.49 (s, 2H), 4.67 (s, 2H), 7.33 (d, 2H, J=8.2Hz), 7.38 (d, 2H, J=8.2Hz). | | References | [1] Patent: US6506770, 2003, B1
[2] Patent: US6872714, 2005, B1
[3] Journal of Medicinal Chemistry, 2010, vol. 53, # 3, p. 1250 - 1260
[4] European Journal of Medicinal Chemistry, 2015, vol. 104, p. 127 - 138
[5] Journal of Labelled Compounds and Radiopharmaceuticals, 2017, vol. 60, # 10, p. 466 - 480 |
| | 4-BROMO METHYLBENZYL ALCOHOL Preparation Products And Raw materials |
|