|
|
| | (-)-Isopinocampheol Basic information |
| Product Name: | (-)-Isopinocampheol | | Synonyms: | ISOPINOCAMPHEOL, (-)-;(-)3-PINANOL;3-PINANOL;(1R,2R,3R,5S)-2,6,6-TRIMETHYL-BICYCLO[3.1.1]HEPTAN-3-OL;(1R,2R,3R,5S)-3-PINANOL;(1R,2R,3R,5S)-(-)-ISOPINOCAMPHEOL;(-)-Isopinocampheol, (1R,2R,3R,5S)-3-Pinanol, 3-Pinanol, (1R,2R,3R,5S)-2,6,6-Trimethylbicyclo[3.1.1]heptan-3-ol;(1R,2R,3R,5S)-2,6,6-Trimethylbicyclo[3.1.1]heptan-3-ol, (1R,2R,3R,5S)-3-Pinanol | | CAS: | 25465-65-0 | | MF: | C10H18O | | MW: | 154.25 | | EINECS: | 247-011-9 | | Product Categories: | Plant Oils, Toxins, Phenolic Acids & Derivatives | | Mol File: | 25465-65-0.mol |  |
| | (-)-Isopinocampheol Chemical Properties |
| Melting point | 52-55 °C | | alpha | -34 º (c=20, EtOH) | | Boiling point | 219 °C(lit.) | | density | 0.8389 (rough estimate) | | refractive index | 1.4710 (estimate) | | Fp | 200 °F | | pka | 15.35±0.60(Predicted) | | form | solid | | Optical Rotation | [α]22/D 34°, c = 20 in ethanol | | BRN | 2038100 | | InChI | 1S/C10H18O/c1-6-8-4-7(5-9(6)11)10(8,2)3/h6-9,11H,4-5H2,1-3H3/t6-,7+,8-,9-/m1/s1 | | InChIKey | REPVLJRCJUVQFA-BZNPZCIMSA-N | | SMILES | C[C@H]1[C@H](O)CC2CC1C2(C)C | | LogP | 2.720 (est) |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | (-)-Isopinocampheol Usage And Synthesis |
| Purification Methods | Dissolve it in Et2O, dry over MgSO4, filter, evaporate, then recrystallise it from pet ether. Also recrystallise it from aqueous EtOH and distil it in a vacuum. [Kergomard & Geneix Bull Soc Chim Fr 394 1958, Zweifel & Brown J Am Chem Soc 86 393 1964.] The 3,4-dinitrobenzoyl derivative has m 100-101o, the phenylcarbamoyl derivative has m 137-138o and the acid -phthalate has m 125-126o. [Beilstein 6 III 282, 283.] |
| | (-)-Isopinocampheol Preparation Products And Raw materials |
|