|
|
| | 2-Chloro-6-methyl-3-pyridinecarbonitrile Basic information | | Uses |
| | 2-Chloro-6-methyl-3-pyridinecarbonitrile Chemical Properties |
| Melting point | 114-116 °C (lit.) | | Boiling point | 140-145 °C (lit.) | | density | 1.2763 (rough estimate) | | refractive index | 1.5500 (estimate) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Chloroform, Methanol | | pka | -1.21±0.10(Predicted) | | form | Solid | | color | Pale Yellow | | BRN | 120414 | | InChI | InChI=1S/C7H5ClN2/c1-5-2-3-6(4-9)7(8)10-5/h2-3H,1H3 | | InChIKey | YSBNBAYNISAUIT-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(C)=CC=C1C#N | | CAS DataBase Reference | 28900-10-9(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Chloro-3-cyano-6-methylpyridine(28900-10-9) |
| Hazard Codes | Xn,T | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36/37/39-22 | | RIDADR | 3276 | | WGK Germany | 3 | | Hazard Note | Toxic | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29333990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 2-Chloro-6-methyl-3-pyridinecarbonitrile Usage And Synthesis |
| Uses | 2-Chloro-6-methyl-3-pyridinecarbonitrile, is a building block used for the synthesis of various biologically active compounds. It can be used for the preparation of 2-(Alkoxycarbonyl)-3-Anilinobenzo[b]thiophenes and Thieno[2,3-b]pyridines as new potent anticancer agents. | | Chemical Properties | light yellow to brown cryst. flakes or needles | | Uses | 2-Chloro-6-methyl-3-pyridinecarbonitrile, is a building block used for the synthesis of various biologically active compounds. It can be used for the preparation of 2-(Alkoxycarbonyl)-3-Anilinobenzo[b]thiophenes and Thieno[2,3-b]pyridines as new potent anticancer agents. | | Uses | 2-Chloro-6-methyl-3-pyridinecarbonitrile (2-chloro-6-methylnicotinonitrile) may be used in the preparation of methyl-2-nitropyridinecarboxamides. | | Synthesis | Step 1: 6-methyl-2-oxo-1,2-dihydropyridine-3-carbonitrile (45.0 g, 335 mmol) was added to phosphorochloridic acid (652 g, 4250 mmol) and the reaction was stirred at 130°C for 2 hours. After the reaction was completed, the reaction solution was concentrated and the resulting residue was dissolved in dichloromethane and the pH was adjusted to 8 by slowly adding 4 M aqueous sodium hydroxide.The organic layer was separated, washed with saturated brine and dried over anhydrous sodium sulfate. The solvent was removed by distillation under reduced pressure to give 2-chloro-6-methylnicotinonitrile (51.0 g, 99% yield).1H NMR (400 MHz, CDCl3) δ 2.65 (s, 3H), 7.24 (d, J = 8.0 Hz, 1H), 7.89 (d, J = 8.0 Hz, 1H). | | References | [1] Patent: US2017/145005, 2017, A1. Location in patent: Paragraph 0149; 0150; 0151; 0152
[2] Heterocycles, 1995, vol. 41, # 6, p. 1307 - 1318
[3] Bioorganic and Medicinal Chemistry Letters, 2008, vol. 18, # 6, p. 2206 - 2210
[4] Polish Journal of Chemistry, 1982, vol. 56, # 2, p. 419 - 423
[5] Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2014, vol. 69, # 5, p. 509 - 518 |
| | 2-Chloro-6-methyl-3-pyridinecarbonitrile Preparation Products And Raw materials |
|