| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | trans-2-Phenyl-1-cyclopropanecarbonyl chloride Basic information |
| | trans-2-Phenyl-1-cyclopropanecarbonyl chloride Chemical Properties |
| Boiling point | 108-110 °C2 mm Hg(lit.) | | density | 1.163 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.556(lit.) | | Fp | >230 °F | | form | liquid | | InChI | 1S/C10H9ClO/c11-10(12)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2/t8-,9+/m0/s1 | | InChIKey | SODZBMGDYKEZJG-DTWKUNHWSA-N | | SMILES | ClC(=O)[C@@H]1C[C@H]1c2ccccc2 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | RTECS | GZ0900000 | | HazardClass | 8 | | PackingGroup | III | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | trans-2-Phenyl-1-cyclopropanecarbonyl chloride Usage And Synthesis |
| Uses | trans-2-Phenyl-1-cyclopropanecarbonyl chloride was used in the synthesis of series of trans-1-[(2-phenylcyclopropyl)methyl]-4-arylpiperazines. |
| | trans-2-Phenyl-1-cyclopropanecarbonyl chloride Preparation Products And Raw materials |
|