| Company Name: |
Shanghai YuanYe Biotechnology Co., Ltd.
|
| Tel: |
021-61312847; 18021002903 |
| Email: |
3008007409@qq.com |
| Products Intro: |
Product Name:2-Methyl-4,7,8-trichloroquinoline
CAS:108097-02-5
Purity:>=97% Package:1g Remarks:Y19947
|
|
| | 2-METHYL-4,7,8-TRICHLOROQUINOLINE Basic information |
| Product Name: | 2-METHYL-4,7,8-TRICHLOROQUINOLINE | | Synonyms: | 2-METHYL-4,7,8-TRICHLOROQUINOLINE;4,7,8-TRICHLOROQUINALDINE;4,7,8-trichloro-2-methylquinoline;Quinoline, 4,7,8-trichloro-2-methyl-;2-Methyl-4,7,8-trichloroquinoline;8-Quinolinyl diphenylphosphinite | | CAS: | 108097-02-5 | | MF: | C10H6Cl3N | | MW: | 246.52 | | EINECS: | | | Product Categories: | | | Mol File: | 108097-02-5.mol |  |
| | 2-METHYL-4,7,8-TRICHLOROQUINOLINE Chemical Properties |
| Boiling point | 336.3±37.0 °C(Predicted) | | density | 1.459±0.06 g/cm3(Predicted) | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 0.15±0.50(Predicted) | | color | Light Beige to Beige | | InChI | 1S/C10H6Cl3N/c1-5-4-8(12)6-2-3-7(11)9(13)10(6)14-5/h2-4H,1H3 | | InChIKey | YWSNYNKOWMWXRR-UHFFFAOYSA-N | | SMILES | Cc1cc(Cl)c2ccc(Cl)c(Cl)c2n1 |
| Hazard Codes | T | | Risk Statements | 25-41 | | Safety Statements | 26-39-45 | | RIDADR | UN 2811 6.1 / PGIII | | WGK Germany | 3 | | HS Code | 2933499090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Aquatic Chronic 4
Eye Dam. 1 |
| | 2-METHYL-4,7,8-TRICHLOROQUINOLINE Usage And Synthesis |
| | 2-METHYL-4,7,8-TRICHLOROQUINOLINE Preparation Products And Raw materials |
|