(S)-(+)-1-METHOXY-2-PROPYLAMINE manufacturers
|
| | (S)-(+)-1-METHOXY-2-PROPYLAMINE Basic information |
| Product Name: | (S)-(+)-1-METHOXY-2-PROPYLAMINE | | Synonyms: | (S)-1-METHOXY-2-AMINOPROPANE;(S)-(+)-1-METHOXY-2-PROPYLAMINE;2-Propanamine, 1-methoxy-, (2S)-;(S)-1-Methoxypropan-2-aMine;(S)-1-Methoxy-2-propylamine ChiPros(R), produced by BASF, 99%;(1S)-2-methoxy-1-methylethylamine;(2S)-1-methoxypropan-2-amine;(S)-2-Amino-1-methoxypropane | | CAS: | 99636-32-5 | | MF: | C4H11NO | | MW: | 89.14 | | EINECS: | 700-220-3 | | Product Categories: | | | Mol File: | 99636-32-5.mol |  |
| | (S)-(+)-1-METHOXY-2-PROPYLAMINE Chemical Properties |
| Melting point | -95°C | | Boiling point | 92-94°C 68mm | | density | 0,844 g/cm3 | | refractive index | 1.4044 | | Fp | 9°C | | storage temp. | 2-8°C, protect from light | | pka | 8.84±0.10(Predicted) | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Water Solubility | Fully miscible in water. | | Sensitive | Air Sensitive | | BRN | 5725728 | | InChI | InChI=1S/C4H11NO/c1-4(5)3-6-2/h4H,3,5H2,1-2H3/t4-/m0/s1 | | InChIKey | NXMXETCTWNXSFG-BYPYZUCNSA-N | | SMILES | C(OC)[C@@H](N)C | | CAS DataBase Reference | 99636-32-5 | | EPA Substance Registry System | 2-Propanamine, 1-methoxy-, (2S)- (99636-32-5) |
| Hazard Codes | F,C | | Risk Statements | 11-22-35-52/53-37-34 | | Safety Statements | 16-23-26-36/37/39-45-61 | | RIDADR | 2734 | | WGK Germany | 3 | | TSCA | TSCA listed | | HazardClass | 3 | | PackingGroup | II | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 4 Oral
Flam. Liq. 2
Skin Corr. 1A
STOT SE 3 |
| Provider | Language |
|
ALFA
| English |
| | (S)-(+)-1-METHOXY-2-PROPYLAMINE Usage And Synthesis |
| Uses | (S)-(+)-1-Methoxy-2-propylamine is a important organic intermediate. It can be used in agrochemical, pharmaceutical and dyestuff field. | | Uses | (S)-1-Methoxy-2-propylamine can be used:
- As an intermediate in the synthesis of piperazinebenzylamine based human MC4 receptor antagonists.
- To prepare imidazopyrimidine derivatives as potent p38 MAP kinase inhibitors.
- In the synthesis of a marine natural product nhatrangin A.
|
| | (S)-(+)-1-METHOXY-2-PROPYLAMINE Preparation Products And Raw materials |
|