|
|
| | 1,10-PHENANTHROLINE-2,9-DICARBOXYLIC ACID Basic information |
| Product Name: | 1,10-PHENANTHROLINE-2,9-DICARBOXYLIC ACID | | Synonyms: | 1,10-PHENANTHROLINE-2,9-DICARBOXYLIC ACID HYDRATE, 98%;2,9-dicarboxy-1,10-phenanthroline;2,9-Dicarboxylicacid-1,10-phenanthroline;1,10-PHENANTHROLINE-2,9-DICARBOXYLIC ACID;1,10-PHENTHROLINE-2,9-DICARBOXYLIC ACID;2,9-dicarboxylic acid;1,10-PHENANTHROLINE-2,9-DICARBOXYLIC ACID ISO 9001:2015 REACH;DK7507 | | CAS: | 57709-61-2 | | MF: | C14H8N2O4 | | MW: | 268.22 | | EINECS: | | | Product Categories: | MOFS COFS | | Mol File: | 57709-61-2.mol |  |
| | 1,10-PHENANTHROLINE-2,9-DICARBOXYLIC ACID Chemical Properties |
| Melting point | 239 °C(Solv: methanol (67-56-1)) | | Boiling point | 563.1±45.0 °C(Predicted) | | density | 1.585±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | pka | 0.61±0.30(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C14H8N2O4/c17-13(18)9-5-3-7-1-2-8-4-6-10(14(19)20)16-12(8)11(7)15-9/h1-6H,(H,17,18)(H,19,20) | | InChIKey | FXSVCROWUPWXBP-UHFFFAOYSA-N | | SMILES | N1C2C(=CC=C3C=2N=C(C(O)=O)C=C3)C=CC=1C(O)=O | | CAS DataBase Reference | 57709-61-2 |
| Risk Statements | 36/38 | | Safety Statements | 26 |
| Provider | Language |
|
ALFA
| English |
| | 1,10-PHENANTHROLINE-2,9-DICARBOXYLIC ACID Usage And Synthesis |
| Uses | 1,10-Phenanthroline-2,9-dicarboxylic acid hydrate is used to produce 1,10-phenanthroline-2,9-dicarbonyl chloride. | | Synthesis | General procedure for the synthesis of 2,9-dicarboxy-1,10-phenanthroline from 2,9-bis(trichloromethyl)-1,10-phenanthroline: 2,9-bis(trichloromethyl)-1,10-phenanthroline (540 mg, 1.3 mmol, 1.0 eq.) was dissolved in a concentrated aqueous sulfuric acid solution (95-98%, 17 mL), and the reaction was stirred for 7 hr at 85 °C. Upon completion of the reaction, the brown reaction solution was cooled to room temperature and slowly poured onto crushed ice. After the ice was completely melted, the resulting white suspension was filtered under vacuum, washed thoroughly with water and dried in air to obtain the pure 2,9-dicarboxy-1,10-phenanthroline (360 mg, quantitative yield). The product characterization data were as follows: 1H NMR (300 MHz, DMSO-d6): δ= 8.22 (s, 2H), 8.42 (d, 3J = 8.4 Hz, 2H), 8.74 (d, 3J = 8.4 Hz, 2H); melting point 215-216 °C (decomposition). | | References | [1] Synlett, 2018, vol. 29, # 10, p. 1362 - 1366 [2] Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1996, # 1, p. 75 - 82 [3] Journal of Heterocyclic Chemistry, 1981, vol. 18, p. 599 - 602 |
| | 1,10-PHENANTHROLINE-2,9-DICARBOXYLIC ACID Preparation Products And Raw materials |
|