|
|
| | Phenosafranin Basic information |
| Product Name: | Phenosafranin | | Synonyms: | 3,7-DIAMINO-5-PHENYLPHENAZINIUM CHLORIDE;CI 50200;CI NO 50200;3,7-diamino-5-phenyl-phenaziniuchloride;nsc9855;Phenazinium,3,7-diamino-5-phenyl-,chloride;phenosafranine,chloride;2,8-DiaMino-10-phenyl-phenaziniuM Chloride | | CAS: | 81-93-6 | | MF: | C18H15ClN4 | | MW: | 322.8 | | EINECS: | 201-387-0 | | Product Categories: | Amines;Aromatics;Mutagenesis Research Chemicals | | Mol File: | 81-93-6.mol |  |
| | Phenosafranin Chemical Properties |
| Melting point | 300 °C | | Boiling point | 478.49°C (rough estimate) | | density | 1.1738 (rough estimate) | | refractive index | 1.6110 (estimate) | | storage temp. | room temp | | form | Solid | | Colour Index | 50200 | | color | Green to dark green | | λmax | 519 nm | | Merck | 13,7333 | | BRN | 3642082 | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C18H14N4.ClH/c19-12-6-8-15-17(10-12)22(14-4-2-1-3-5-14)18-11-13(20)7-9-16(18)21-15;/h1-11H,(H3,19,20);1H | | InChIKey | SOUHUMACVWVDME-UHFFFAOYSA-N | | SMILES | [Cl-].Nc1ccc2nc3ccc(N)cc3[n+](-c4ccccc4)c2c1 | | CAS DataBase Reference | 81-93-6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | SG1630000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | Phenosafranin Usage And Synthesis |
| Chemical Properties | green crystalline powder | | Uses | Phenosafranin is a bacterial stain used in microscopy, biological stain, and nuclear staining. | | Definition | ChEBI: Phenosafranine is an organic chloride salt having 3,7-diamino-5-phenylphenazin-5-ium as the counterion. It is commonly used for staining Gram negative bacteria red in smears to contrast with the blue Gram positive organisms. It has a role as a fluorochrome, a histological dye and a photosensitizing agent. It contains a 3,7-diamino-5-phenylphenazin-5-ium. | | Biochem/physiol Actions | Phenosafranin (PSF) is a red dye released from cells with intact plasma membrane. PSF at lower concentration is used to stain mitochondria supravitally. | | Staining Procedures | Phenosafranin is used to distinguish living from dead cells. A 0.1 % aqueous solution, it is taken up by dead or abnormal cells immediately, while living cells remain unstained for at least 30 min. | | Purification Methods | Crystallise the chloride from dilute HCl. It has UV with at 530nm in H2O. The picrate decomposes on heating and has a solubility of 0.0048% in H2O at 18o. [Beilstein 23 H 395, Beilstein 25 H 394, 25 I 654, 25 II 338, 25 III/IV 3050.] |
| | Phenosafranin Preparation Products And Raw materials |
|