|
|
| | Linezolid Impurity 21 Basic information |
| Product Name: | Linezolid Impurity 21 | | Synonyms: | Linezolid Impurity 21;Methyl (3-Fluoro-4-morpholinophenyl)carbamate;(3-Fluoro-4-morpholin-4-ylphenyl)carbamic Acid Methyl Ester;Carbamic acid, [3-fluoro-4-(4-morpholinyl)phenyl]-, methyl ester (9CI);Methyl N-(3-fluoro-4-morpholin-4-ylphenyl)carbamate;Methyl (3-fluoro-4-morpholinophenyl)carbamate (Linezolid Impurity);Carbamic acid, N-[3-fluoro-4-(4-morpholinyl)phenyl]-, methyl ester;N-carbomethoxy-3-fluoro-4-morpholinylaniline | | CAS: | 212325-40-1 | | MF: | C12H15FN2O3 | | MW: | 254.26 | | EINECS: | | | Product Categories: | | | Mol File: | 212325-40-1.mol |  |
| | Linezolid Impurity 21 Chemical Properties |
| Melting point | 159-161°C | | Boiling point | 341.3±42.0 °C(Predicted) | | density | 1.294±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Chloroform (Slightly), Methanol (Slightly) | | pka | 12.80±0.70(Predicted) | | form | Solid | | color | Pale Beige to Pale Brown | | InChI | InChI=1S/C12H15FN2O3/c1-17-12(16)14-9-2-3-11(10(13)8-9)15-4-6-18-7-5-15/h2-3,8H,4-7H2,1H3,(H,14,16) | | InChIKey | IKISJVHYIWZBRX-UHFFFAOYSA-N | | SMILES | C(OC)(=O)NC1=CC=C(N2CCOCC2)C(F)=C1 |
| | Linezolid Impurity 21 Usage And Synthesis |
| Uses | (3-Fluoro-4-morpholin-4-ylphenyl)carbamic Acid Methyl Ester is an impurity of Linezolid (L466500), a prototype of the oxazolidinone antimicrobials; inhibits bacterial mRNA translation;Also, it is derived from 3-Fluoro-4-(4-morpholinyl) Benzenamine (F595895), which is an intermediate in the synthesis of Linezolid (L466500) |
| | Linezolid Impurity 21 Preparation Products And Raw materials |
|