- Monosodium fumarate
-
- $0.00 / 25KG
-
2026-02-12
- CAS:7704-73-6
- Min. Order: 25KG
- Purity: 98%min
- Supply Ability: 30tons/month
- Monosodium fumarate
-
- $10.00 / 1KG
-
2026-01-30
- CAS:7704-73-6
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 10 mt
- Monosodium fumarate
-
- $0.00 / 25kg
-
2025-12-01
- CAS:7704-73-6
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| | Monosodium fumarate Basic information |
| Product Name: | Monosodium fumarate | | Synonyms: | FUMARIC ACID DISODIUM SALT;FUMARIC ACID SODIUM SALT;2-Butenedioicacid,(E)-,sodiumsalt;SODIUM FUMARATE DISODIUM SALT;SODIUM FUMARATE;C4H3O4NA 98+%;Monosodiumtrans-1,2-ethylenedicarboxylicacid;Monosodium fumarate | | CAS: | 7704-73-6 | | MF: | C4H3NaO4 | | MW: | 138.05 | | EINECS: | 231-725-2 | | Product Categories: | | | Mol File: | 7704-73-6.mol |  |
| | Monosodium fumarate Chemical Properties |
| Odor | at 100.00%. odorless | | Cosmetics Ingredients Functions | BUFFERING | | InChI | InChI=1S/C4H4O4.Na/c5-3(6)1-2-4(7)8;/h1-2H,(H,5,6)(H,7,8);/q;+1/p-1/b2-1+; | | InChIKey | VRVKOZSIJXBAJG-TYYBGVCCSA-M | | SMILES | [Na+].C([O-])(=O)/C=C/C(O)=O | | LogP | -0.008 (est) | | CAS DataBase Reference | 7704-73-6(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | LT1830000 | | F | 3 |
| | Monosodium fumarate Usage And Synthesis |
| Description | Monosodium fumarate is also known as sodium fumarate and monosodium fumarate. White crystal powder. Odorless, with a special taste. The monosodium salt is prepared by the reaction of fumaric acid and sodium hydroxide, and it is obtained by recrystallization. Used as sour condiments, such as powdered refreshing drinks, canned fruits, cold foods, jams, etc., and also used as synthetic raw materials for synthetic resins and mordants. | | Uses | Monosodium fumarate is used as acidulant, buffer, flavoring agent, antioxidant aid. It is used to prepare wine, soft drinks, confectionary products, powdered juices, canned fruits, cold drinks, jams, jelly, etc. Formulated as a compound leavening agent for bread, cookies, etc. It is often used in combination with other organic acids such as DL-malic acid and citric acid. |
| | Monosodium fumarate Preparation Products And Raw materials |
|