|
|
| | MLS6585 Basic information |
| Product Name: | MLS6585 | | Synonyms: | MLS6585;4-Pyridinecarboxamide, N-[3-(aminocarbonyl)-6-(1,1-dimethylethyl)-4,5,6,7-tetrahydrobenzo[b]thien-2-yl]- | | CAS: | 389080-71-1 | | MF: | C19H23N3O2S | | MW: | 357.47 | | EINECS: | | | Product Categories: | | | Mol File: | 389080-71-1.mol |  |
| | MLS6585 Chemical Properties |
| Boiling point | 430.8±45.0 °C(Predicted) | | density | 1.264±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: 2mg/mL, clear | | form | powder | | pka | 11.42±0.40(Predicted) | | color | white to beige | | InChI | 1S/C19H23N3O2S/c1-19(2,3)12-4-5-13-14(10-12)25-18(15(13)16(20)23)22-17(24)11-6-8-21-9-7-11/h6-9,12H,4-5,10H2,1-3H3,(H2,20,23)(H,22,24) | | InChIKey | IMEICQDRTCGLFX-UHFFFAOYSA-N | | SMILES | [s]1c2c(c(c1NC(=O)c3ccncc3)C(=O)N)CCC(C2)C(C)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | MLS6585 Usage And Synthesis |
| Biochem/physiol Actions | CID 2886111 is a D1 dopamine receptor positive allosteric modulator (PAM) that binds to a different allosteric site than other D1 PAMs such as DETQ and compound B. |
| | MLS6585 Preparation Products And Raw materials |
|