|
|
| | (5-METHYL-2-FURYL)METHANOL Basic information |
| Product Name: | (5-METHYL-2-FURYL)METHANOL | | Synonyms: | 5-Methyl-2-furanMethanol, 97% 5GR;5-Methyl-2-furanMethanol, GC 97%;(5-Methylfur-2-yl)methanol, 5-Methylfurfuryl alcohol;5-Methyl-2-furfuryl alkohol;RARECHEM AL BD 0010;5-methyl-2-furfuryl alcohol;5-methylfurfuryl alcohol;5-METHYL-2-FURANMETHANOL 97% | | CAS: | 3857-25-8 | | MF: | C6H8O2 | | MW: | 112.13 | | EINECS: | | | Product Categories: | Heterocyclic Compounds;Heterocycles | | Mol File: | 3857-25-8.mol |  |
| | (5-METHYL-2-FURYL)METHANOL Chemical Properties |
| Boiling point | 80°C 15mm | | density | 1.0769 | | FEMA | 4544 | 5-METHYLFURFURYL ALCOHOL | | refractive index | 1.4835-1.4855 | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | pka | 14.04±0.10(Predicted) | | form | Liquid | | color | Clear yellow | | Odor | sweet caramellic | | JECFA Number | 2099 | | Stability: | Hygroscopic | | InChI | InChI=1S/C6H8O2/c1-5-2-3-6(4-7)8-5/h2-3,7H,4H2,1H3 | | InChIKey | VOZFDEJGHQWZHU-UHFFFAOYSA-N | | SMILES | O1C(C)=CC=C1CO | | LogP | 0.66 | | CAS DataBase Reference | 3857-25-8 |
| Hazard Codes | Xn | | Risk Statements | 20/21/22-22 | | Safety Statements | 36/37 | | RIDADR | 2810 | | WGK Germany | WGK 3 | | HS Code | 29321900 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Acute Tox. 4 Oral |
| Provider | Language |
|
ACROS
| English |
| | (5-METHYL-2-FURYL)METHANOL Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liqui | | Uses | 5-Methyl-2-furanmethanol (cas# 3857-25-8) is a compound useful in organic synthesis. |
| | (5-METHYL-2-FURYL)METHANOL Preparation Products And Raw materials |
|