Methylguanidine hydrochloride manufacturers
|
| | Methylguanidine hydrochloride Basic information |
| | Methylguanidine hydrochloride Chemical Properties |
| Melting point | 121-124°C | | RTECS | MF3990000 | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | solubility | DMSO (Slightly), Methanol (Slightly), Water (Slightly) | | form | Powder | | color | White to off-white | | Water Solubility | Soluble in water (50 mg/ml - clear, colorless to light yellow solution). | | Sensitive | Hygroscopic | | Stability: | Hygroscopic | | InChI | InChI=1S/C2H7N3.ClH/c1-5-2(3)4;/h1H3,(H4,3,4,5);1H | | InChIKey | VJQCNCOGZPSOQZ-UHFFFAOYSA-N | | SMILES | N(C)C(=N)N.[H]Cl | | CAS DataBase Reference | 22661-87-6(CAS DataBase Reference) |
| | Methylguanidine hydrochloride Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | N-Methylguanidine is an alkylated guanidine which shows inhibitory action against trypsin catalysis. N-Methylguanidine inhibited metabolism of certain hepatic drugs that was mediated by cytochrome P 450 protein in human liver microsome and hepatocyte. | | Definition | ChEBI: 1-Methylguanidine hydrochloride is a member of guanidines. |
| | Methylguanidine hydrochloride Preparation Products And Raw materials |
|