|
|
| | 4-Bromo-3-fluorobenzotrifluoride Basic information |
| Product Name: | 4-Bromo-3-fluorobenzotrifluoride | | Synonyms: | 2-FLUORO-4-(TRIFLUOROMETHYL)BROMOBENZENE;1-Bromo-2-fluoro-4-(trifluoromethyl)benzene~2-Fluoro-4-(trifluoromethyl)bromobenzene;3-fluoro-4-bromobenzotrifluoride;1-BROMO-2-FLUORO-4-(TRIFLUOROMETHYL)BENZENE;4-Bromo-3-fluorobenzotrifluoride 97%;4-Bromo-3-fluorobenzotrifluoride97%;4-BROMO-3-FLUOROBENZOTRIFLUORIDE;4-BROMO-3-FLUOROBENZOTRIFLUORIDE, 98.5% | | CAS: | 40161-54-4 | | MF: | C7H3BrF4 | | MW: | 243 | | EINECS: | | | Product Categories: | Fluorine series;Trifluoromethylbenzene serise | | Mol File: | 40161-54-4.mol |  |
| | 4-Bromo-3-fluorobenzotrifluoride Chemical Properties |
| Boiling point | 154-155°C | | density | 1.72 | | refractive index | 1.46 | | Fp | 154-155°C | | storage temp. | Sealed in dry,Room Temperature | | form | clear liquid | | color | Colorless to Almost colorless | | BRN | 2641902 | | InChI | InChI=1S/C7H3BrF4/c8-5-2-1-4(3-6(5)9)7(10,11)12/h1-3H | | InChIKey | XCTQZIUCYJVRLJ-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(C(F)(F)F)C=C1F | | CAS DataBase Reference | 40161-54-4(CAS DataBase Reference) |
| Provider | Language |
|
ALFA
| English |
| | 4-Bromo-3-fluorobenzotrifluoride Usage And Synthesis |
| Chemical Properties | liquid | | Uses | 4-BroMo-3-fluorobenzotrifluoride is a useful Laboratory chemical，and it can auses skin irritation and eye irritation. |
| | 4-Bromo-3-fluorobenzotrifluoride Preparation Products And Raw materials |
|