|
|
| | 2,3,4,6-tetra-O-benzyl-D-galactopyranose Basic information |
| Product Name: | 2,3,4,6-tetra-O-benzyl-D-galactopyranose | | Synonyms: | 2,3,4,6-Tetrakis-O-(phenylMethyl)-;D-Galactose,2,3,4,6-tetrakis-O-(phenylMethyl)-;2,3,4,6-tetrabenzylgalactopyranose;(2R,3S,4S,5R)-2,3,4,6-Tetrakis(benzyloxy)-5-hydroxyhexanal;2,3,4,6-TETRA-O-BENZYL-D-GALACTOPYRANOSIDE;2,3,4,6-TETRA-O-BENZYL-D-GALACTOSE;2,3,4,6-TETRA-O-BENZYL-D-GALACTOPYRANOSE;2,3,4,6-Tetra-O-benzyl-D-galactopyranose,98% | | CAS: | 53081-25-7 | | MF: | C34H36O6 | | MW: | 540.65 | | EINECS: | 610-955-0 | | Product Categories: | 13C & 2H Sugars;Carbohydrates & Derivatives;Carbohydrates;Carbohydrates A to;Carbohydrates P-ZBiochemicals and Reagents;Monosaccharide;C13-C60;Carbohydrates P-Z;Aldehydes;Biochemicals and Reagents;Building Blocks;Carbohydrates A to Z;Carbonyl Compounds;Chemical Synthesis;Organic Building Blocks | | Mol File: | 53081-25-7.mol |  |
| | 2,3,4,6-tetra-O-benzyl-D-galactopyranose Chemical Properties |
| Melting point | 60-63 °C | | Boiling point | 576.06°C (rough estimate) | | density | 1.0726 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Acetone (Slightly), Chloroform (Slightly), DMF (Sparingly) | | pka | 13.33±0.20(Predicted) | | form | Crystals or Crystalline Powder | | color | White to almost white | | Optical Rotation | α25D +11±2, c = 1 in CHCl3 ; α20D +10.5±2, c = 1 in CHCl3 | | Water Solubility | Insoluble in water. | | Stability: | Store in freezer | | InChI | InChI=1/C34H36O6/c35-21-32(38-23-28-15-7-2-8-16-28)34(40-25-30-19-11-4-12-20-30)33(39-24-29-17-9-3-10-18-29)31(36)26-37-22-27-13-5-1-6-14-27/h1-21,31-34,36H,22-26H2/t31-,32+,33+,34-/s3 | | InChIKey | OGOMAWHSXRDAKZ-BJPULKCASA-N | | SMILES | [C@@]([H])(OCC1C=CC=CC=1)([C@H](C=O)OCC1C=CC=CC=1)[C@@H](OCC1C=CC=CC=1)[C@H](O)COCC1C=CC=CC=1 |&1:0,10,21,30,r| | | CAS DataBase Reference | 53081-25-7(CAS DataBase Reference) |
| | 2,3,4,6-tetra-O-benzyl-D-galactopyranose Usage And Synthesis |
| Description | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose is a protected carbohydrate derivative, precisely a benzylated form of D-galactopyranose. This compound is often used in organic synthesis, particularly in preparing glycosyl donors and other carbohydrate derivatives. The benzyl groups serve as protecting groups, which can be removed under specific conditions to yield the free sugar.
| | Chemical Properties | White Powder | | Uses | 2,3,4,6-Tetra-O-benzyl-D-galactopyranose (cas# 53081-25-7) is a compound useful in organic synthesis. | | Application | 2,3,4,6-tetra-O-benzyl-D-galactopyranose is a structural unit that serves as both a galactosyl donor and an acceptor in the synthesis of sugars. It can also be used as a pharmaceutical intermediate and has been used in the synthesis of potential cholera toxin inhibitors, iNKT agonists and Scleropentaside A. |
| | 2,3,4,6-tetra-O-benzyl-D-galactopyranose Preparation Products And Raw materials |
|