| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
LaaJoo |
| Tel: |
021-60702684 18516024827 |
| Email: |
huang.jiayi@sinocompound.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | Nickel(II) hexafluoroacetylacetonate hydrate Basic information |
| Product Name: | Nickel(II) hexafluoroacetylacetonate hydrate | | Synonyms: | NICKEL HEXAFLUOROACETYLACETONATE HYDRATE;NICKEL II HEXAFLUOROPENTANEDIONATE, HYDRATE;Nickel(II) hexafluoroacetylacetonate hydrate 98%;Nickel, bis(1,1,1,5,5,5-hexafluoro-2,4-pentanedionato-κO,κO′)-, hydrate, (SP-4-1)-;Nickel(II) hexafluoroacetylacetonate hydrate | | CAS: | 207569-13-9 | | MF: | C10H4F12NiO5 | | MW: | 490.81 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | Nickel(II) hexafluoroacetylacetonate hydrate Chemical Properties |
| Melting point | 213 °C (dec.) (lit.) | | form | solid | | InChI | 1S/2C5H2F6O2.Ni.H2O/c2*6-4(7,8)2(12)1-3(13)5(9,10)11;;/h2*1,12H;;1H2/q;;+2;/p-2/b2*2-1-;; | | InChIKey | OMCOVIODBHSWJG-SUXDNRKISA-L | | SMILES | O.FC(F)(F)C(=O)\C=C(/O[Ni]O\C(=C/C(=O)C(F)(F)F)C(F)(F)F)C(F)(F)F |
| Hazard Codes | T | | Risk Statements | 45-20/21/22-36/37/38-42/43 | | Safety Statements | 53-26-36/37/39-45 | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Carc. 1B
Eye Irrit. 2
Resp. Sens. 1
Skin Irrit. 2
Skin Sens. 1
STOT SE 3 |
| | Nickel(II) hexafluoroacetylacetonate hydrate Usage And Synthesis |
| reaction suitability | core: nickel
reagent type: catalyst |
| | Nickel(II) hexafluoroacetylacetonate hydrate Preparation Products And Raw materials |
|