|
|
| | DL-4-Hydroxyphenyl(alanine-1-13C) Basic information |
| | DL-4-Hydroxyphenyl(alanine-1-13C) Chemical Properties |
| Melting point | >300 °C (dec.)(lit.) | | density | 1.334±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | form | solid | | InChI | 1S/C9H11NO3/c10-8(9(12)13)5-6-1-3-7(11)4-2-6/h1-4,8,11H,5,10H2,(H,12,13)/i9+1 | | InChIKey | OUYCCCASQSFEME-QBZHADDCSA-N | | SMILES | NC(Cc1ccc(O)cc1)[13C](O)=O | | CAS Number Unlabeled | 556-03-6 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | DL-4-Hydroxyphenyl(alanine-1-13C) Usage And Synthesis |
| | DL-4-Hydroxyphenyl(alanine-1-13C) Preparation Products And Raw materials |
|