| Company Name: |
Beijing ECom Technology Co., Ltd. Gold
|
| Tel: |
17710328343 |
| Email: |
3004011422@qq.com |
| Products Intro: |
Product Name:3-methyl-1,7-bis(5-oxohexyl)-1H-purine-2,6(3H,7H)-dione
CAS:200556-62-3
Purity:大于95% HPLC Package:10mg,25mg,50mg,100mg
|
| Company Name: |
S.Z. PhyStandard Bio-Tech. Co., Ltd.
|
| Tel: |
0755-4000505016 13380397412 |
| Email: |
3001272453@qq.com |
| Products Intro: |
Product Name:Pentoxifylline EP Impurity H
CAS:200556-62-3
Purity:98% HPLC Package:10mg;50mg;100mg
|
|
| | Pentoxifylline Impurity 8(Pentoxifylline EP Impurity H) Basic information |
| Product Name: | Pentoxifylline Impurity 8(Pentoxifylline EP Impurity H) | | Synonyms: | Pentoxifylline Impurity 8(Pentoxifylline EP Impurity H);1,7-Bis-(5-oxohexyl)-3-methylxanthi;1H-Purine-2,6-dione, 3,7-dihydro-3-methyl-1,7-bis(5-oxohexyl)-;Pentoxifylline Impurity 8（Pentoxifylline EP Impurity A）;3,7-Dihydro-3-methyl-1,7-bis(5-oxohexyl)-1H-purine-2,6-dione;3-methyl-1,7-bis(5-oxohexyl)-3,7-dihydro-1H-purine-2,6-dione;EP impurity H;Pentoxifylline Impurity H | | CAS: | 200556-62-3 | | MF: | C18H26N4O4 | | MW: | 362.42 | | EINECS: | | | Product Categories: | | | Mol File: | 200556-62-3.mol |  |
| | Pentoxifylline Impurity 8(Pentoxifylline EP Impurity H) Chemical Properties |
| Boiling point | 607.4±65.0 °C(Predicted) | | density | 1.25±0.1 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 0.54±0.70(Predicted) | | Appearance | Off-white to light yellow Solid | | InChI | InChI=1S/C18H26N4O4/c1-13(23)8-4-6-10-21-12-19-16-15(21)17(25)22(18(26)20(16)3)11-7-5-9-14(2)24/h12H,4-11H2,1-3H3 | | InChIKey | QANXTEAQVXUYGN-UHFFFAOYSA-N | | SMILES | N1(CCCCC(=O)C)C2=C(N(C)C(=O)N(CCCCC(=O)C)C2=O)N=C1 |
| | Pentoxifylline Impurity 8(Pentoxifylline EP Impurity H) Usage And Synthesis |
| Uses | 3,7-Dihydro-3-methyl-1,7-bis(5-oxohexyl)-1H-purine-2,6-dione is an impurity of Pentoxifylline (P276500), a metabolite of Pentifylline. Methylxanthine derivative that improves blood flow by decreasing blood viscosity (1). Phosphodiesterase inhibitor (2). Inhibits the synthesis of tumor necrosis factor α (TNF-α). |
| | Pentoxifylline Impurity 8(Pentoxifylline EP Impurity H) Preparation Products And Raw materials |
|