| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | Trifluoromethyl 4-Methylbenzenesulfonate Basic information |
| | Trifluoromethyl 4-Methylbenzenesulfonate Chemical Properties |
| Boiling point | 244.7±40.0 °C(Predicted) | | density | 1.410±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen, away from moisture | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C8H7F3O3S/c1-6-2-4-7(5-3-6)15(12,13)14-8(9,10)11/h2-5H,1H3 | | InChIKey | NHBKFPDJMAEDOS-UHFFFAOYSA-N | | SMILES | C(OS(C1=CC=C(C)C=C1)(=O)=O)(F)(F)F |
| | Trifluoromethyl 4-Methylbenzenesulfonate Usage And Synthesis |
| | Trifluoromethyl 4-Methylbenzenesulfonate Preparation Products And Raw materials |
|