BDP 558/568 carboxylic acid manufacturers
|
| | BDP 558/568 carboxylic acid Basic information |
| Product Name: | BDP 558/568 carboxylic acid | | Synonyms: | BDP 558/568 carboxylic acid;BODIPY 558/568 carboxylic acid;BDP 558/568 COOH;3-(5,5-Difluoro-7-(thiophen-2-yl)-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-3-yl)propanoic acid;BDP558 acid;3-(5,5-Difluoro-7-(thiophen-2-yl)-5H-5l4,6l4-dipyrrolo[1,2-c:2',1'-f][1,3,2]diazaborinin-3-yl)propanoic acid;N4-acetyl-1-(2-deoxy-2-fluoro-5-O-DMTr-β-D-arabinofuranosyl)-5-methoxycarbonylcytosine-3-O-(2-cyanoethyl)-N,N-diisopropyl phosphoramidite | | CAS: | 150173-72-1 | | MF: | C16H13BF2N2O2S | | MW: | 346.16 | | EINECS: | | | Product Categories: | | | Mol File: | 150173-72-1.mol |  |
| | BDP 558/568 carboxylic acid Chemical Properties |
| solubility | Soluble in DCM, DMF, DMSO | | Appearance | Dark brown flake solid | | ex/em | 561/569 nm | | ε(extinction coefficient) | 84400 L⋅mol−1⋅cm−1 | | Φ(quantum yield) | 0.68 | | InChI | InChI=1S/C16H13BF2N2O2S/c18-17(19)20-11(6-8-16(22)23)3-4-12(20)10-13-5-7-14(21(13)17)15-2-1-9-24-15/h1-5,7,9-10H,6,8H2,(H,22,23) | | InChIKey | ZVTFVFIEVANQLT-UHFFFAOYSA-N | | SMILES | [F-][B+3]1([N-]2C(=CC=C2C=C2C=CC(C3SC=CC=3)=N12)CCC(=O)[O-])[F-].[H+] |
| | BDP 558/568 carboxylic acid Usage And Synthesis |
| Description | BDP 558/568 carboxylic acid is a BDP linker containing a carboxylic acid. The BDP 558/568 has similar excitation and emission wavelengths to Cy3. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. | | Chemical Properties | Appearance: Dark brown flaky solid
ex/em: 561/569 nm
Extinction coefficient (ε): 84400 Lmol1cm1
Quantum yield (Φ): 0.68 | | Uses | BDP 558/568 carboxylic acid is a BDP linker containing a carboxylic acid. The BDP 558/568 has similar excitation and emission wavelengths to Cy3. The terminal carboxylic acid can react with primary amine groups in the presence of activators (e.g. EDC, or HATU) to form a stable amide bond. |
| | BDP 558/568 carboxylic acid Preparation Products And Raw materials |
|