|
| 5-BROMO-2,4-DIMETHOXYPYRIMIDINE Basic information |
| 5-BROMO-2,4-DIMETHOXYPYRIMIDINE Chemical Properties |
Melting point | 62-65 °C (lit.) | Boiling point | 125 °C / 17mmHg | density | 1.563±0.06 g/cm3(Predicted) | storage temp. | Sealed in dry,Room Temperature | solubility | Acetone, Dichloromethane | pka | 1.27±0.29(Predicted) | form | Powder or Crystalline Powder | color | White to pale yellow | InChI | InChI=1S/C6H7BrN2O2/c1-10-5-4(7)3-8-6(9-5)11-2/h3H,1-2H3 | InChIKey | QEZIMQMMEGPYTR-UHFFFAOYSA-N | SMILES | C1(OC)=NC=C(Br)C(OC)=N1 | CAS DataBase Reference | 56686-16-9(CAS DataBase Reference) |
Hazard Codes | Xi,Xn | Safety Statements | 24/25 | WGK Germany | 3 | HS Code | 29335990 |
| 5-BROMO-2,4-DIMETHOXYPYRIMIDINE Usage And Synthesis |
Chemical Properties | White Crystalline Solid |
| 5-BROMO-2,4-DIMETHOXYPYRIMIDINE Preparation Products And Raw materials |
|