- 2,2'-DINITRODIBENZYL
-
- $3.00 / 1KG
-
2020-02-01
- CAS:16968-19-7
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: 100KG
|
| | 2,2'-DINITRODIBENZYL Basic information |
| Product Name: | 2,2'-DINITRODIBENZYL | | Synonyms: | 2,2'-DINITROBIBENZYL;1,2-BIS(2-NITROPHENYL)ETHANE;1,1’-(1,2-ethanediyl)bis(2-nitro-benzen;1-Nitro-2-[2-(2-nitrophenyl)ethyl]benzene;2,2’-dinitro-bibenzy;Benzene, 1,1'-(1,2-ethanediyl)bis[2-nitro-;Bibenzyl, 2,2'-dinitro-;1,1'-(1,2-Ethanediyl)Bis[2-Nitro-Benzene] | | CAS: | 16968-19-7 | | MF: | C14H12N2O4 | | MW: | 272.26 | | EINECS: | 241-043-7 | | Product Categories: | | | Mol File: | 16968-19-7.mol |  |
| | 2,2'-DINITRODIBENZYL Chemical Properties |
| Melting point | 122°C | | Boiling point | 391.6±22.0 °C(Predicted) | | density | 1.317±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Very Slightly, Heated) | | form | Solid | | color | Pale Brown to Light Brown | | InChI | InChI=1S/C14H12N2O4/c17-15(18)13-7-3-1-5-11(13)9-10-12-6-2-4-8-14(12)16(19)20/h1-8H,9-10H2 | | InChIKey | YBOZRPPSBVIHGJ-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1[N+]([O-])=O)CC1=CC=CC=C1[N+]([O-])=O | | CAS DataBase Reference | 16968-19-7(CAS DataBase Reference) |
| | 2,2'-DINITRODIBENZYL Usage And Synthesis |
| Chemical Properties | light yellow powder | | Uses | 2,2''-Dinitrodibenzyl is an intermediate in the synthesis of Carbamazepine (C175840), an antiepileptic drug that is used to treat patients with trigeminal neuralgia and psychiatric disorders (such as depression and bipolar disorder). |
| | 2,2'-DINITRODIBENZYL Preparation Products And Raw materials |
| Raw materials | 1-nitro-4-phenethyl-benzene-->Benzene, 1-nitro-2-(2-phenylethyl)--->Benzene, 1-nitro-2-[2-(4-nitrophenyl)ethyl]--->Benzene,1,1'-(1,2-ethanediyl)bis(2,4-dinitro-)-->2-(2-nitrophenyl)ethyl 4-methylbenzene-1-sulfonate-->11,12-Dihydrodibenzo[c,g][1,2]diazocine-5-oxide-->Benzene, 1-methyl-2-nitro-3-[(phenylsulfonyl)methyl]--->1-Bromo-2-nitrobenzene-->CHLOROMETHYL PHENYL SULFONE-->4-Iodo-2-nitrotoluene-->Benzaldehyde-->2,2'-ETHYLENEDIANILINE-->2-Nitrotoluene | | Preparation Products | 4,4'-DINITROBIBENZYL-->4-Methylpyridine |
|