- laurophenone
-
- $200.00 / 1KG
-
2025-09-25
- CAS:1674-38-0
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
|
| | LAUROPHENONE Basic information |
| | LAUROPHENONE Chemical Properties |
| Melting point | 44-47 °C | | Boiling point | 214-215 °C (16 mmHg) | | density | 0.8794 | | refractive index | 1.4700 (estimate) | | Fp | 201-202°C/9mm | | storage temp. | Store at room temperature | | form | powder to crystal | | color | White to Light yellow | | BRN | 2050785 | | InChI | InChI=1S/C18H28O/c1-2-3-4-5-6-7-8-9-13-16-18(19)17-14-11-10-12-15-17/h10-12,14-15H,2-9,13,16H2,1H3 | | InChIKey | DJNJZIFFCJTUDS-UHFFFAOYSA-N | | SMILES | C(C1=CC=CC=C1)(=O)CCCCCCCCCCC | | CAS DataBase Reference | 1674-38-0(CAS DataBase Reference) | | EPA Substance Registry System | Dodecanophenone (1674-38-0) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29143900 |
| | LAUROPHENONE Usage And Synthesis |
| Chemical Properties | white to beige crystalline mass or powder | | Uses | 1-Phenyldodecan-1-one is used in micellar electrokinetic chromatography (MEC) systems. |
| | LAUROPHENONE Preparation Products And Raw materials |
|