|
|
| | BOC-D-Leucine monohydrate Basic information |
| | BOC-D-Leucine monohydrate Chemical Properties |
| Melting point | 85-87 °C(lit.) | | Boiling point | 356.0±25.0 °C(Predicted) | | density | 1.061±0.06 g/cm3(Predicted) | | refractive index | 25 ° (C=2, AcOH) | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | solubility | Acetic Acid (Sparingly), DMSO (Slightly), Methanol (Slightly) | | pka | 4.02±0.21(Predicted) | | form | Solid | | color | White | | BRN | 2331060 | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H21NO4/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14)/t8-/m1/s1 | | InChIKey | MDXGYYOJGPFFJL-MRVPVSSYSA-N | | SMILES | C(O)(=O)[C@@H](CC(C)C)NC(OC(C)(C)C)=O | | CAS DataBase Reference | 16937-99-8(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HS Code | 29241990 | | Storage Class | 11 - Combustible Solids |
| | BOC-D-Leucine monohydrate Usage And Synthesis |
| Chemical Properties | White crystalline | | Uses | N-Boc-D-leucine is an N-Boc-protected form of D-Leucine (L330150). D-Leucine is an unnatural isomer of L-Leucine (L330110) that acts as an auto-inhibitor of lactic streptococci in culture. D-Leucine causes analgesia in humans and also exhibits inhibitory activity in bacterial cell cultures. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-D-Leucine monohydrate Preparation Products And Raw materials |
|