- 1-BROMO-2-METHYLPROPENE
-
- $100.00 / 1KG
-
2025-09-25
- CAS:3017-69-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 1-BROMO-2-METHYLPROPENE Basic information |
| | 1-BROMO-2-METHYLPROPENE Chemical Properties |
| Melting point | -115.07°C (estimate) | | Boiling point | 92 °C (lit.) | | density | 1.318 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.462(lit.) | | Fp | 46 °F | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | BRN | 1733844 | | InChI | InChI=1S/C4H7Br/c1-4(2)3-5/h3H,1-2H3 | | InChIKey | DEFNUDNHTUZJAL-UHFFFAOYSA-N | | SMILES | C(/Br)=C(\C)/C | | CAS DataBase Reference | 3017-69-4 |
| Hazard Codes | F,Xi | | Risk Statements | 11-36/37/38 | | Safety Statements | 16-26-33 | | RIDADR | UN 1993 3/PG 2 | | WGK Germany | 3 | | F | 8-19 | | HazardClass | 3.1 | | PackingGroup | II |
| | 1-BROMO-2-METHYLPROPENE Usage And Synthesis |
| Uses | 1-Bromo-2-methyl-1-propene has been used in:
- preparation of esters of 2,4-dienoic acids via palladium catalyzed reaction with methyl acrylate in the presence of triethylamine
- total synthesis of ocular age pigment, A2-E
- synthesis of 3-nor-geraniol [2H2]
|
| | 1-BROMO-2-METHYLPROPENE Preparation Products And Raw materials |
|