| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | N-Trityl-1,2-ethanediamine hydrobromide Basic information |
| | N-Trityl-1,2-ethanediamine hydrobromide Chemical Properties |
| Melting point | 187-189 °C | | storage temp. | 2-8°C | | InChI | 1S/C21H22N2.BrH/c22-16-17-23-21(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20;/h1-15,23H,16-17,22H2;1H | | InChIKey | ILSWDBONXPWRBT-UHFFFAOYSA-N | | SMILES | Br[H].NCCNC(c1ccccc1)(c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | F | 3-10 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-Trityl-1,2-ethanediamine hydrobromide Usage And Synthesis |
| reaction suitability | reagent type: cross-linking reagent |
| | N-Trityl-1,2-ethanediamine hydrobromide Preparation Products And Raw materials |
|