|
|
| | 3-Amino-2-pyridinecarboxylic acid Basic information |
| | 3-Amino-2-pyridinecarboxylic acid Chemical Properties |
| Melting point | 218-220 | | Boiling point | 386.6±27.0 °C(Predicted) | | density | 1.417±0.06 g/cm3(Predicted) | | RTECS | US5175000 | | storage temp. | Keep in dark place,Inert atmosphere,Store in freezer, under -20°C | | solubility | Soluble in acetone, ethanol and methanol. | | form | Solid | | pka | 1.32±0.50(Predicted) | | color | Yellow to pale brown | | InChI | InChI=1S/C6H6N2O2/c7-4-2-1-3-8-5(4)6(9)10/h1-3H,7H2,(H,9,10) | | InChIKey | BOOMHTFCWOJWFO-UHFFFAOYSA-N | | SMILES | C1(C(O)=O)=NC=CC=C1N | | CAS DataBase Reference | 1462-86-8(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37-60 | | HazardClass | IRRITANT | | HS Code | 29333990 |
| | 3-Amino-2-pyridinecarboxylic acid Usage And Synthesis |
| Chemical Properties | Green/Brown Crystals | | Uses | 3-Amino-2-pyridinecarboxylic acid is a useful synthetic intermediate. | | Uses | Employed as an important intermediate for syntheses material and pharmaceutical. | | Application | 3-Aminopicolinic Acid is used in the preparation of piperidinyl-methyl-purinamines as NSD2 inhibitors and anti-cancer agents. | | Synthesis | (2) Preparation of 3-aminopyridine-2-carboxylic acid: 3-nitropyridine-2-carboxylic acid (2.72 g, 16.2 mmol) and sodium bicarbonate (1.34 g, 16.2 mmol) were dissolved in distilled water (20 mL). The atmosphere in the system was replaced with nitrogen to exclude oxygen. After adding 10% palladium carbon catalyst (1.72 g), the atmosphere in the system was replaced with hydrogen and the reaction was stirred at room temperature for 50 hours. After completion of the reaction, the pH of the reaction solution was adjusted to weakly acidic by adding 1N aqueous hydrochloric acid. The solvent was removed by distillation under reduced pressure and a small amount of ethanol and ethyl acetate was added to the residue and the resulting precipitate was collected by filtration. The filtrate was concentrated to afford the target product 3-aminopyridine-2-carboxylic acid (1.50 g, 67% yield) as a light yellow solid. | | References | [1] Patent: US2005/182045, 2005, A1. Location in patent: Page/Page column 74 |
| | 3-Amino-2-pyridinecarboxylic acid Preparation Products And Raw materials |
|