- Fmoc-Phe(4-Cl)-OH
-
- $52.00 / 100mg
-
2025-04-29
- CAS:175453-08-4
- Min. Order:
- Purity:
- Supply Ability: 10g
|
| (S)-N-FMOC-4-Chlorophenylalanine Basic information |
| (S)-N-FMOC-4-Chlorophenylalanine Chemical Properties |
Melting point | 138 °C | Boiling point | 640.9±55.0 °C(Predicted) | density | 1.1529 (rough estimate) | refractive index | 1.6290 (estimate) | storage temp. | 2-8°C | solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. | pka | 3.72±0.10(Predicted) | form | Solid | color | White to off-white | BRN | 9437838 | InChIKey | CQPNKLNINBUUOM-QFIPXVFZSA-N | SMILES | C(O)(=O)[C@H](CC1=CC=C(Cl)C=C1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O | CAS DataBase Reference | 175453-08-4(CAS DataBase Reference) |
Hazard Codes | Xi | Safety Statements | 24/25 | WGK Germany | 3 | HazardClass | IRRITANT | HS Code | 29242990 |
| (S)-N-FMOC-4-Chlorophenylalanine Usage And Synthesis |
Chemical Properties | off-white powder | Uses | peptide synthesis | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| (S)-N-FMOC-4-Chlorophenylalanine Preparation Products And Raw materials |
|