| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Labnetwork lnc. |
| Tel: |
+86-27-50766799 +86-18062016861 |
| Email: |
contact@labnetwork.com |
|
| | trans-2-Chloro-3 4-dimethoxy-β-nitrosty& Basic information |
| Product Name: | trans-2-Chloro-3 4-dimethoxy-β-nitrosty& | | Synonyms: | (E)-2-Chloro-3,4-dimethoxy-1-(2-nitrovinyl)benzene;2-CHLORO-3,4-DIMETHOXY-TRANS-BETA-NITRO&;trans-2-chloro-3,4-dimethoxy-β-nitrostyrene;2-CHLORO-3,4-DIMETHOXY-BETA-NITROSTYRENE;1,2-Dimethoxy-3-chloro-4-(2-nitrovinyl)benzene, 2-(2-Chloro-3,4-dimethoxyphenyl)nitroethene;2-Chloro-3,4-dimethoxy-β-nitrostyrene;Benzene, 2-chloro-3,4-dimethoxy-1-(2-nitroethenyl)-;2-chloro-3,4-dimethoxy-1-(2-nitrovinyl)benzene | | CAS: | 41122-35-4 | | MF: | C10H10ClNO4 | | MW: | 243.64 | | EINECS: | | | Product Categories: | | | Mol File: | 41122-35-4.mol |  |
| | trans-2-Chloro-3 4-dimethoxy-β-nitrosty& Chemical Properties |
| Melting point | 89-93 °C (lit.) | | Boiling point | 374.8±37.0 °C(Predicted) | | density | 1.305±0.06 g/cm3(Predicted) | | storage temp. | Refrigerator | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | color | Yellow | | InChI | 1S/C10H10ClNO4/c1-15-8-4-3-7(5-6-12(13)14)9(11)10(8)16-2/h3-6H,1-2H3/b6-5+ | | InChIKey | PXDQNCVFROGRNW-AATRIKPKSA-N | | SMILES | COc1ccc(\C=C\[N+]([O-])=O)c(Cl)c1OC |
| Hazard Codes | Xi | | Risk Statements | 36-43 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Sens. 1 |
| | trans-2-Chloro-3 4-dimethoxy-β-nitrosty& Usage And Synthesis |
| Uses | 2-Chloro-3,4-dimethoxy-β-nitrostyrene is an intermediate in the synthesis of high affinity D1 dopamine receptor ligand. |
| | trans-2-Chloro-3 4-dimethoxy-β-nitrosty& Preparation Products And Raw materials |
|