|
|
| | 1 5-DICHLORO-3-PENTANONE Basic information |
| Product Name: | 1 5-DICHLORO-3-PENTANONE | | Synonyms: | 1 5-DICHLORO-3-PENTANONE;3-PENTANONE, 1,5-DICHLORO- (6CI,7CI,8CI,9CI);3Pentanone1,5Dichloro;Bis(2-chloroethyl) ketone. 2,2-Dichlorodiethyl ketone;1,5-DichloRopentan-3-one - Technical Grade;1,5-dichlorpentan-3-on;1,5-Dichloropentan-3-one | | CAS: | 3592-25-4 | | MF: | C5H8Cl2O | | MW: | 155.02 | | EINECS: | | | Product Categories: | API intermediates | | Mol File: | 3592-25-4.mol |  |
| | 1 5-DICHLORO-3-PENTANONE Chemical Properties |
| Boiling point | 74 °C(Press: 0.8 Torr) | | density | 1.183±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | liquid | | color | Dark brown | | InChI | InChI=1S/C5H8Cl2O/c6-3-1-5(8)2-4-7/h1-4H2 | | InChIKey | LYJQMHVYFFZQGY-UHFFFAOYSA-N | | SMILES | C(Cl)CC(=O)CCCl | | CAS DataBase Reference | 3592-25-4(CAS DataBase Reference) |
| Hazard Codes | Xi,T | | Risk Statements | 25 | | Safety Statements | 36-45 | | RIDADR | 1993 | | HazardClass | 3 | | PackingGroup | Ⅲ | | HS Code | 2914790090 |
| | 1 5-DICHLORO-3-PENTANONE Usage And Synthesis |
| Chemical Properties | yellow to light brown liquid |
| | 1 5-DICHLORO-3-PENTANONE Preparation Products And Raw materials |
|