4-FLUOROCINNAMOYL CHLORIDE 97 manufacturers
|
| | 4-FLUOROCINNAMOYL CHLORIDE 97 Basic information |
| | 4-FLUOROCINNAMOYL CHLORIDE 97 Chemical Properties |
| Melting point | 42-46 °C(lit.) | | Boiling point | 90 °C0.1 mm Hg(lit.) | | density | 1.289±0.06 g/cm3(Predicted) | | Fp | >230 °F | | form | solid | | InChI | 1S/C9H6ClFO/c10-9(12)6-3-7-1-4-8(11)5-2-7/h1-6H/b6-3+ | | InChIKey | GLBIKPKWQDIQCJ-ZZXKWVIFSA-N | | SMILES | [H]\C(=C(\[H])c1ccc(F)cc1)C(Cl)=O |
| Hazard Codes | T | | Risk Statements | 25-34-36/38 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 2928 6.1/PG 2 | | WGK Germany | 2 | | HazardClass | 6.1, 8 | | Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | | Hazard Classifications | Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 |
| | 4-FLUOROCINNAMOYL CHLORIDE 97 Usage And Synthesis |
| | 4-FLUOROCINNAMOYL CHLORIDE 97 Preparation Products And Raw materials |
|