|
|
| | 3-BROMO-4-NITROBENZOIC ACID 97 Basic information |
| | 3-BROMO-4-NITROBENZOIC ACID 97 Chemical Properties |
| Melting point | 200-204 °C | | Boiling point | 364.4±32.0 °C(Predicted) | | density | 1.892±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 3.03±0.10(Predicted) | | color | White to Light yellow to Light orange | | InChI | 1S/C7H4BrNO4/c8-5-3-4(7(10)11)1-2-6(5)9(12)13/h1-3H,(H,10,11) | | InChIKey | KKPPNEJUUOQRLE-UHFFFAOYSA-N | | SMILES | OC(=O)c1ccc(c(Br)c1)[N+]([O-])=O | | CAS DataBase Reference | 101420-81-9 |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | HS Code | 2916399090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 3-BROMO-4-NITROBENZOIC ACID 97 Usage And Synthesis |
| Uses | Substrate linked to a solid support via the carboxyl group which is used in a Bartoli synthesis of indoles. |
| | 3-BROMO-4-NITROBENZOIC ACID 97 Preparation Products And Raw materials |
|