| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | (1S 2r)-1-phenyl-2-(1-pyrrolidinyl)-1- Basic information |
| | (1S 2r)-1-phenyl-2-(1-pyrrolidinyl)-1- Chemical Properties |
| Melting point | 43-47 °C(lit.) | | Boiling point | 321.268±22.00 °C(Press: 760.00 Torr)(predicted) | | density | 1.076±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | | Fp | >230 °F | | storage temp. | 2-8°C | | pka | 13.890±0.20(predicted) | | Optical Rotation | [α]20/D 15°, c = 2 in chloroform | | InChI | 1S/C13H19NO/c1-11(14-9-5-6-10-14)13(15)12-7-3-2-4-8-12/h2-4,7-8,11,13,15H,5-6,9-10H2,1H3/t11-,13-/m1/s1 | | InChIKey | FZVHJGJBJLFWEX-DGCLKSJQSA-N | | SMILES | C[C@H]([C@@H](O)c1ccccc1)N2CCCC2 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | (1S 2r)-1-phenyl-2-(1-pyrrolidinyl)-1- Usage And Synthesis |
| Uses | (1S,2R)-1-Phenyl-2-(1-pyrrolidinyl)-1-propanol can be used as:
- A chiral catalyst to prepare corresponding enantioselective secondary aromatic alcohols by the addition of dialkylzincs to aromatic aldehydes.
- A reactant to synthesize optically active (R)-(+)-1-phenyl-2-(1-pyrrolidinyl)-1-propanone by oxidation reaction.
|
| | (1S 2r)-1-phenyl-2-(1-pyrrolidinyl)-1- Preparation Products And Raw materials |
|