|
|
| | N-[3-(DIMETHYLAMINO)PROPYL]LAURAMIDE Basic information |
| | N-[3-(DIMETHYLAMINO)PROPYL]LAURAMIDE Chemical Properties |
| Melting point | 34.5-38.5 °C(lit.) | | Boiling point | 171-194 °C(Press: 2 Torr) | | density | 0.882±0.06 g/cm3(Predicted) | | Fp | >230 °F | | solubility | Chloroform (Slightly), Methanol (Slightly) | | pka | 16.29±0.46(Predicted) | | form | Low-Melting Solid | | color | White to Off-White | | Cosmetics Ingredients Functions | ANTISTATIC | | Cosmetic Ingredient Review (CIR) | N-[3-(DIMETHYLAMINO)PROPYL]LAURAMIDE (3179-80-4) | | InChI | InChI=1S/C17H36N2O/c1-4-5-6-7-8-9-10-11-12-14-17(20)18-15-13-16-19(2)3/h4-16H2,1-3H3,(H,18,20) | | InChIKey | TWMFGCHRALXDAR-UHFFFAOYSA-N | | SMILES | C(NCCCN(C)C)(=O)CCCCCCCCCCC | | LogP | 4.561 (est) | | Surface tension | 27.8mN/m at 1g/L and 20℃ | | EPA Substance Registry System | Dodecanamide, N-[3-(dimethylamino)propyl]- (3179-80-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 2 | | TSCA | TSCA listed | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N-[3-(DIMETHYLAMINO)PROPYL]LAURAMIDE Usage And Synthesis |
| Uses | N-(3-(Dimethylamino)propyl)dodecanamide is used in the study of surface chemistry and colloids as a new surfactnt for hydrate anti-agglomeration in hydrocarbon flowlines and seabed oil capture. |
| | N-[3-(DIMETHYLAMINO)PROPYL]LAURAMIDE Preparation Products And Raw materials |
|