| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | AZURE A EOSINATE, PURE Basic information |
| | AZURE A EOSINATE, PURE Chemical Properties |
| storage temp. | room temp | | form | powder or crystals | | color | green to black | | λmax | 522 nm (2nd)
628 nm | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C14H13N3S.ClH/c1-17(2)10-4-6-12-14(8-10)18-13-7-9(15)3-5-11(13)16-12;/h3-8,15H,1-2H3;1H | | InChIKey | NALREUIWICQLPS-UHFFFAOYSA-N | | SMILES | [Cl-].C\[N+](C)=C1/C=CC2=Nc3ccc(N)cc3SC2=C1 | | CAS DataBase Reference | 62298-43-5 |
| WGK Germany | 3 | | HS Code | 32041900 | | Storage Class | 11 - Combustible Solids |
| | AZURE A EOSINATE, PURE Usage And Synthesis |
| Chemical Properties | green crystalline powder | | Uses | diagnostic assay manufacturing
hematology
histology | | Definition | ChEBI: 3-amino-7-(dimethylamino)phenothiazin-5-ium is an organic cation that is phenothiazin-5-ium substituted by amino and dimethylamino groups at positions 3 and 7 respectively. The chloride salt is the histological dye 'azure A'. |
| | AZURE A EOSINATE, PURE Preparation Products And Raw materials |
|