- HEDP
-
- $1.00 / 1PCS
-
2026-03-20
- CAS:3794-83-0
- Min. Order: 1PCS
- Purity: 99%
- Supply Ability: 10 mt
|
| | (1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt Basic information |
| Product Name: | (1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt | | Synonyms: | Sodium Salt of 1-Hydroxyethylene -1, 1,-Diphosphonic Acid HEDP.4Na;1-Hydroxyethylidene-1,1-diphosphonicacid,tetrasodiumsalt;deflocen43;dequest2016;ethane-1-hydroxy-1,1-diphosphonicacid,tetrasodiumsalt;Phosphonicacid,(1-hydroxyethylidene)bis-,tetrasodiumsalt;tetrasodium 1-hydroxyethylidene diphosphonate;tetra sodium hydroxyethylidene diphosphonate | | CAS: | 3794-83-0 | | MF: | C2H9NaO7P2 | | MW: | 230.02 | | EINECS: | 223-267-7 | | Product Categories: | Phosphonate antiscalant | | Mol File: | 3794-83-0.mol |  |
| | (1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt Chemical Properties |
| density | 2.074[at 20℃] | | vapor pressure | 0Pa at 25℃ | | solubility | Aqueous Acid (Slightly), Water (Sparingly) | | pka | 2.18[at 20 ℃] | | form | Solid | | color | White to Off-White | | Water Solubility | 774g/L at 20℃ | | Stability: | Hygroscopic | | Cosmetics Ingredients Functions | CHELATING
EMULSION STABILISING
VISCOSITY CONTROLLING | | InChI | InChI=1S/C2H8O7P2.Na.H/c1-2(3,10(4,5)6)11(7,8)9;;/h3H,1H3,(H2,4,5,6)(H2,7,8,9);; | | InChIKey | MFKOTRZLMIUIGE-UHFFFAOYSA-N | | SMILES | C(O)(C)(P(O)(O)=O)P(O)(O)=O.[NaH] | | LogP | -3 at 23℃ | | CAS DataBase Reference | 3794-83-0(CAS DataBase Reference) | | EPA Substance Registry System | Phosphonic acid, (1-hydroxyethylidene)bis-, tetrasodium salt (3794-83-0) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/38-36-22 | | Safety Statements | 26-36/37/39-36 | | RTECS | JL6475000 | | TSCA | TSCA listed | | Toxicity | rat,LD50,oral,990mg/kg (990mg/kg),KIDNEY, URETER, AND BLADDER: CHANGES IN BOTH TUBULES AND GLOMERULI,Toxicology and Applied Pharmacology. Vol. 22, Pg. 661, 1972. |
| | (1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt Usage And Synthesis |
| Uses | (1-Hydroxyethylidene)bis-phosphonic Acid Tetrasodium Salt is used in method for applying a gel compound on a surface of a device and corresponding coated device. | | Flammability and Explosibility | Not classified |
| | (1-Hydroxyethylidene)bis-phosphonic acid tetrasodium salt Preparation Products And Raw materials |
|