|
|
| | Estradiol-3-benzoate-17-butyrate Basic information |
| Product Name: | Estradiol-3-benzoate-17-butyrate | | Synonyms: | 17β-butyryloxy-3-benzoyloxy-estratriene-(A);B-ESTRADIOL 3-BENZOATE 17-N-BUTYRATE;estra-1,3,5(10)-triene-3,17beta-diol 3-benzoate 17-butyrate;oestradiol benzoate 17-n-butyrate;Estra-1,3,5(10)-triene-3,17β-diol 3-benzoate 17-butanoate;Estra-1,3,5(10)-triene-3,17b-diol 3-benzoate 17-butyrate;Estradiol-3-benzoate-17-butyrate;Estradiol Benzoate Butyrate | | CAS: | 63042-18-2 | | MF: | C29H34O4 | | MW: | 446.58 | | EINECS: | 263-807-9 | | Product Categories: | APIs | | Mol File: | 63042-18-2.mol |  |
| | Estradiol-3-benzoate-17-butyrate Chemical Properties |
| Melting point | 128.5-129.0 °C | | Boiling point | 558.6±50.0 °C(Predicted) | | density | 1.18±0.1 g/cm3(Predicted) | | storage temp. | Sealed in dry,2-8°C | | InChIKey | MKYFGNOOEKZNPW-PFQOISFUNA-N | | SMILES | [C@@]12([H])CC[C@H](OC(=O)CCC)[C@@]1(C)CC[C@]1([H])C3C=CC(OC(=O)C4C=CC=CC=4)=CC=3CC[C@@]21[H] |&1:0,4,11,15,34,r| |
| | Estradiol-3-benzoate-17-butyrate Usage And Synthesis |
| | Estradiol-3-benzoate-17-butyrate Preparation Products And Raw materials |
|