|
|
| | 4-METHOXY-3-NITROBENZYL ALCOHOL 97 Basic information |
| | 4-METHOXY-3-NITROBENZYL ALCOHOL 97 Chemical Properties |
| Melting point | 68-71 °C (lit.) | | Boiling point | 367.3±27.0 °C(Predicted) | | density | 1.316±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 13.57±0.10(Predicted) | | form | solid | | Appearance | Off-white to light yellow Solid | | InChI | 1S/C8H9NO4/c1-13-8-3-2-6(5-10)4-7(8)9(11)12/h2-4,10H,5H2,1H3 | | InChIKey | XJVDLGZUYYAXLS-UHFFFAOYSA-N | | SMILES | COc1ccc(CO)cc1[N+]([O-])=O |
| WGK Germany | 3 | | HS Code | 2909498090 | | Storage Class | 11 - Combustible Solids |
| | 4-METHOXY-3-NITROBENZYL ALCOHOL 97 Usage And Synthesis |
| General Description | 4-Methoxy-3-nitrobenzyl alcohol is an organic building block. |
| | 4-METHOXY-3-NITROBENZYL ALCOHOL 97 Preparation Products And Raw materials |
|