| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532; 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:4-Chloro-4'-Methyl-3-nitrobenzophenone CAS:40306-24-9 Package:100g,25g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Email: |
sales8178@energy-chemical.com |
| Products Intro: |
Product Name:4-Chloro-4′-Methyl-3-nitrobenzophenone CAS:40306-24-9 Purity:97% Package:25G
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:4-Chloro-4′-methyl-3-nitrobenzophenone CAS:40306-24-9 Purity:95+% Remarks:B34775
|
|
| | 4-CHLORO-4'-METHYL-3-NITRO BENZOPHENONE& Basic information |
| | 4-CHLORO-4'-METHYL-3-NITRO BENZOPHENONE& Chemical Properties |
| Melting point | 117-121 °C(lit.) | | Boiling point | 441.1±40.0 °C(Predicted) | | density | 1.327±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | soluble in Chloroform, Methanol | | form | Solid | | color | Off-White to Pale Yellow | | InChI | 1S/C14H10ClNO3/c1-9-2-4-10(5-3-9)14(17)11-6-7-12(15)13(8-11)16(18)19/h2-8H,1H3 | | InChIKey | ZRCRGBZPAADXJT-UHFFFAOYSA-N | | SMILES | Cc1ccc(cc1)C(=O)c2ccc(Cl)c(c2)[N+]([O-])=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 4-CHLORO-4'-METHYL-3-NITRO BENZOPHENONE& Usage And Synthesis |
| Chemical Properties | Off-White to Pale Yellow Solid | | Uses | 4-Chloro-4'-methyl-3-nitrobenzophenone is a benzophenone derivative used in the preparation of nitrogen-containing heterocycles. | | Uses | 4-Chloro-4''-methyl-3-nitrobenzophenone is a benzophenone derivative used in the preparation of nitrogen-containing heterocycles. |
| | 4-CHLORO-4'-METHYL-3-NITRO BENZOPHENONE& Preparation Products And Raw materials |
|