| Company Name: |
Energy Chemical |
| Tel: |
400-0056266 |
| Email: |
sales8178@energy-chemical.com |
|
| | trans-3-(4-Chlorobenzoyl)acrylic acid Basic information |
| | trans-3-(4-Chlorobenzoyl)acrylic acid Chemical Properties |
| Melting point | 130-134 °C (lit.) | | Boiling point | 379.5±42.0 °C(Predicted) | | density | 1.366±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 3.09±0.10(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C10H7ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-6H,(H,13,14)/b6-5+ | | InChIKey | VQVQEUFKSRHRCT-AATRIKPKSA-N | | SMILES | [H]\C(=C(\[H])C(=O)c1ccc(Cl)cc1)C(O)=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | trans-3-(4-Chlorobenzoyl)acrylic acid Usage And Synthesis |
| | trans-3-(4-Chlorobenzoyl)acrylic acid Preparation Products And Raw materials |
|