| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
Energy Chemical |
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
|
| | 2 5-Bis(bromomethyl)-1-methoxy-4-(3'-7'& Basic information |
| Product Name: | 2 5-Bis(bromomethyl)-1-methoxy-4-(3'-7'& | | Synonyms: | 1,4-bis(bromomethyl)-2-(3,7-dimethyloctoxy)-5-methoxybenzene;2,5-Bis(bromomethyl)-1-methoxy-4-(3',7'-dimethyloctyloxy)benzene 96%;1,4-Bis(bromomethyl)-2-(3,7-dimethyloctyloxy)-5-methoxybenzene;Benzene, 1,4-bis(bromomethyl)-2-[(3,7-dimethyloctyl)oxy]-5-methoxy-;2,5-Bis(bromomethyl)-1-methoxy-4-(3',7'-dimethyloctyloxy)benzene;2 5-Bis(bromomethyl)-1-methoxy-4-(3'-7'& | | CAS: | 287919-00-0 | | MF: | C19H30Br2O2 | | MW: | 450.25 | | EINECS: | | | Product Categories: | Organic Electronics and Photonics;Polyphenylenevinylene (PPV, CN-PPV) Monomers;Synthetic Tools and Reagents | | Mol File: | 287919-00-0.mol |  |
| | 2 5-Bis(bromomethyl)-1-methoxy-4-(3'-7'& Chemical Properties |
| Melting point | 74-77 °C (lit.) | | Boiling point | 460.6±40.0 °C(Predicted) | | density | 1.302±0.06 g/cm3(Predicted) | | InChI | 1S/C19H30Br2O2/c1-14(2)6-5-7-15(3)8-9-23-19-11-16(12-20)18(22-4)10-17(19)13-21/h10-11,14-15H,5-9,12-13H2,1-4H3 | | InChIKey | DOKSAXJBKYCNRE-UHFFFAOYSA-N | | SMILES | COc1cc(CBr)c(OCCC(C)CCCC(C)C)cc1CBr |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36 | | RIDADR | UN 1759 8/PG 3 | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Skin Corr. 1B |
| | 2 5-Bis(bromomethyl)-1-methoxy-4-(3'-7'& Usage And Synthesis |
| Uses | Conducting polymer precursor for synthesis of substituted PPV. |
| | 2 5-Bis(bromomethyl)-1-methoxy-4-(3'-7'& Preparation Products And Raw materials |
|