| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
2 3-Dichloro-N-phenylmaleimide manufacturers
|
| | 2 3-Dichloro-N-phenylmaleimide Basic information |
| Product Name: | 2 3-Dichloro-N-phenylmaleimide | | Synonyms: | Maleimide, 2,3-dichloro-N-phenyl-;3,4-dichloro-1-phenyl-pyrrol-2,5-dione;1-Phenyl-3,4-dichloro-3-pyrroline-2,5-dione;3,4-Dichloro-1-phenyl-1H-pyrrole-2,5-dione;N-Phenyl-2,3-dichloromaleimide;3,4-dichloro-1-phenyl-3-pyrroline-2,5-quinone;3,4-dichloro-1-phenyl-pyrrole-2,5-dione;3,4-dichloro-1-phenylpyrrole-2,5-dione | | CAS: | 3876-05-9 | | MF: | C10H5Cl2NO2 | | MW: | 242.06 | | EINECS: | | | Product Categories: | | | Mol File: | 3876-05-9.mol |  |
| | 2 3-Dichloro-N-phenylmaleimide Chemical Properties |
| Melting point | 199-205 °C (lit.) | | Boiling point | 308.6±42.0 °C(Predicted) | | density | 1.57±0.1 g/cm3(Predicted) | | pka | -4.86±0.60(Predicted) | | InChI | 1S/C10H5Cl2NO2/c11-7-8(12)10(15)13(9(7)14)6-4-2-1-3-5-6/h1-5H | | InChIKey | CZLKFADFZAWWBC-UHFFFAOYSA-N | | SMILES | ClC1=C(Cl)C(=O)N(c2ccccc2)C1=O |
| Safety Statements | 22-24/25 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids |
| | 2 3-Dichloro-N-phenylmaleimide Usage And Synthesis |
| Uses | 2,3-Dichloro-N-phenylmaleimide may be used to synthesize:
- N-phenyl-2,3-di(thiophenyl)maleimide
- N-phenyl-2,3-dithiomaleimide
- 2-chloro-3-cyclohexyl-N-phenylmaleimide
- 2,3-dicyclohexyl-N-phenylmaleimide
- 2-benzyl-3-chloro-N-phenylmaleimide
| | General Description | 2,3-Dichloro-N-phenylmaleimide can be prepared from the reaction between 2,3-dichloromaleic anhydride and aniline. |
| | 2 3-Dichloro-N-phenylmaleimide Preparation Products And Raw materials |
|