| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | 5-Nitrobarbituric acid hydrate 95 Basic information |
| Product Name: | 5-Nitrobarbituric acid hydrate 95 | | Synonyms: | 5-NitropyriMidine-2,4,6(1H,3H,5H)-trione xhydrate;5-Nitro-2,4,6-trihydroxypyrimidine, Dilituric Acid;5-Nitrobarbituric acid hydrate 95%;5-Nitrobarbituric acid hydrate 95 | | CAS: | 209529-81-7 | | MF: | C4H5N3O6 | | MW: | 191.099 | | EINECS: | 620-893-6 | | Product Categories: | | | Mol File: | 209529-81-7.mol |  |
| | 5-Nitrobarbituric acid hydrate 95 Chemical Properties |
| Melting point | 183 °C (dec.)(lit.) | | form | powder | | InChI | 1S/C4H3N3O5.H2O/c8-2-1(7(11)12)3(9)6-4(10)5-2;/h1H,(H2,5,6,8,9,10);1H2 | | InChIKey | YKGZAIJTCJOZNK-UHFFFAOYSA-N | | SMILES | O.[O-][N+](=O)C1C(=O)NC(=O)NC1=O |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 5-Nitrobarbituric acid hydrate 95 Usage And Synthesis |
| Uses | Used as a microreagent for potassium with which it forms a characteristic precipitate. |
| | 5-Nitrobarbituric acid hydrate 95 Preparation Products And Raw materials |
|