| Company Name: |
ChengDu TongChuangYuan Pharmaceutical Co.Ltd
|
| Tel: |
28-83379370 13880556291 |
| Email: |
tcy@tcypharm.com |
| Products Intro: |
Product Name:ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate
CAS:1425387-12-7
Purity:99% Package:100g
|
| Company Name: |
Suzhou Sino Rare Chemical Co., Ltd.
|
| Tel: |
0512-62857507 |
| Email: |
sales@sinorarechem.com |
| Products Intro: |
Product Name:ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate
CAS:1425387-12-7
Purity:99% Package:25KG;5KG;1KG
|
| Company Name: |
Guangzhou Zhiya Chemdrugs Co.,Ltd
|
| Tel: |
18122150900 |
| Email: |
sculk28@163.com |
| Products Intro: |
Product Name:ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate
CAS:1425387-12-7
Package:100G/
|
| Company Name: |
ChengDu TongChuangYuan Pharmaceutical Co.Ltd
|
| Tel: |
028-83379370 13880556291 |
| Email: |
tcy@tcypharm.com |
| Products Intro: |
Product Name:ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate
CAS:1425387-12-7
Purity:99% HPLC Package:5KG;1KG
|
|
| | ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate Basic information |
| Product Name: | ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate | | Synonyms: | ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate;5-Pyrimidinecarboxylic acid, 2-chloro-4-methyl-6-(methylthio)-, ethyl ester;ASN002 INT;ethyl 2-chloro-4-methyl-6-methylsulfanylpyrimidine-5-carboxylate;ethyl 2-chloro-4-methyl-6-methylsulfanyl-pyrimidine-5-carboxylate - [E82847] | | CAS: | 1425387-12-7 | | MF: | C9H11ClN2O2S | | MW: | 246.71 | | EINECS: | | | Product Categories: | | | Mol File: | 1425387-12-7.mol |  |
| | ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate Chemical Properties |
| Boiling point | 364.8±42.0 °C(Predicted) | | density | 1.32±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C, stored under nitrogen | | pka | -1.36±0.39(Predicted) | | Appearance | Light yellow to yellow Solid | | InChI | InChI=1S/C9H11ClN2O2S/c1-4-14-8(13)6-5(2)11-9(10)12-7(6)15-3/h4H2,1-3H3 | | InChIKey | JKPPNILEYHBPIL-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC(SC)=C(C(OCC)=O)C(C)=N1 |
| | ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate Usage And Synthesis |
| | ethyl 2-chloro-4-methyl-6-(methylthio)pyrimidine-5-carboxylate Preparation Products And Raw materials |
|