|
|
| | SR-4995 Basic information |
| Product Name: | SR-4995 | | Synonyms: | SR-4995;Urea, N-butyl-N'-(10,11-dihydro-10-methyl-11-oxodibenzo[b,f][1,4]thiazepin-8-yl)- | | CAS: | 891509-95-8 | | MF: | C19H21N3O2S | | MW: | 355.45 | | EINECS: | | | Product Categories: | | | Mol File: | 891509-95-8.mol |  |
| | SR-4995 Chemical Properties |
| Boiling point | 528.8±50.0 °C(Predicted) | | density | 1.259±0.06 g/cm3(Predicted) | | storage temp. | -20°C | | solubility | DMSO: 2mg/mL, clear | | pka | 13.95±0.46(Predicted) | | form | powder | | color | white to beige | | InChI | 1S/C19H21N3O2S/c1-3-4-11-20-19(24)21-13-9-10-17-15(12-13)22(2)18(23)14-7-5-6-8-16(14)25-17/h5-10,12H,3-4,11H2,1-2H3,(H2,20,21,24) | | InChIKey | UGYXUEPBYOKNOL-UHFFFAOYSA-N | | SMILES | CN1C(C(C=CC=C2)=C2SC3=C1C=C(NC(NCCCC)=O)C=C3)=O |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | SR-4995 Usage And Synthesis |
| Uses | SR-4995 (CID 16016685) is a highly effective and selective ligand for α-β-hydrolase domain-containing 5 (ABHD5), facilitating the activation of adipose triglyceride lipase (ATGL) by displacing ABHD5 from its inhibitory regulators, perilipin-1 (PLIN1) and PLIN5. It directly interacts with ABHD5, inhibiting its association with PLIN1, and promotes lipolysis in adipocytes and muscle tissues while circumventing PKA-dependent signaling pathways. | | Biological Activity | SR-4995 is a potent and selective ligand of α-β-hydrolase domain containing 5 (ABHD5) th at activates adipose triglyceride lipase (ATGL) by dissociating ABHD5 from its inhibitory regulator, perilipin-1 (PLIN1) and PLIN5. SR-4995 directly binds to ABHD5 and prevents ABHD5 to PLIN1. SR-4995 induces lipolysis in adipocytes and muscle, avoiding PKA-dependent signaling. |
| | SR-4995 Preparation Products And Raw materials |
|