|
|
| | 4,4'-DIBROMO-4''-PHENYLTRIPHENYLAMINE Basic information |
| Product Name: | 4,4'-DIBROMO-4''-PHENYLTRIPHENYLAMINE | | Synonyms: | N,N-Bis(4-bromophenyl)-4-biphenylamine;N,N-bis(4-bromophenyl)biphenyl-4-amine;N,N-bis(4-bromophenyl)-[1,1’-biphenyl]-4-amine;N,N-BIS(4-BROMOPHENYL)-4-PHENYLANILINE;RDS0692-1801;DBPTPA;[1,1'-Biphenyl]-4-aMine,N,N-bis(4-broMophenyl)-;4,4'-Dibromo-4''-phenyltriphenylamine> | | CAS: | 884530-69-2 | | MF: | C24H17Br2N | | MW: | 479.21 | | EINECS: | | | Product Categories: | Acid Anhydrides, etc. (Reagents for Conducting Polymer Research);Electroluminescence;Functional Materials;Reagents for Conducting Polymer Research | | Mol File: | 884530-69-2.mol |  |
| | 4,4'-DIBROMO-4''-PHENYLTRIPHENYLAMINE Chemical Properties |
| Melting point | 136.0 to 140.0 °C | | Boiling point | 573.6±45.0 °C(Predicted) | | density | 1.505±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Tetrahydrofuran | | form | powder to crystal | | pka | -4.34±0.50(Predicted) | | color | White to Almost white | | InChI | InChI=1S/C24H17Br2N/c25-20-8-14-23(15-9-20)27(24-16-10-21(26)11-17-24)22-12-6-19(7-13-22)18-4-2-1-3-5-18/h1-17H | | InChIKey | BKJULDLPGWGCHY-UHFFFAOYSA-N | | SMILES | C1(C2=CC=CC=C2)=CC=C(N(C2=CC=C(Br)C=C2)C2=CC=C(Br)C=C2)C=C1 | | CAS DataBase Reference | 884530-69-2 |
| Safety Statements | 24/25 | | HS Code | 29215900 |
| | 4,4'-DIBROMO-4''-PHENYLTRIPHENYLAMINE Usage And Synthesis |
| | 4,4'-DIBROMO-4''-PHENYLTRIPHENYLAMINE Preparation Products And Raw materials |
|