| Company Name: |
Xirui Biotech (Suzhou) Co., Ltd Gold
|
| Tel: |
15051477682 15851592819; |
| Email: |
3833346036@qq.com |
| Products Intro: |
Product Name:8-(3,5-difluoropyridin-2-yl)-15-methyl-4-(methylsulfonylmethyl)-14-oxo-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaene-5-carboxylic acid
CAS:2313230-51-0
Purity:97% HPLC Package:100mg;1g;5g
|
PROTAC BRD4 ligand-1 manufacturers
|
| | PROTAC BRD4 ligand-1 Basic information |
| Product Name: | PROTAC BRD4 ligand-1 | | Synonyms: | PROTAC BRD4 ligand-1;2H-2,4,7-Triazadibenz[cd,f]azulene-9-carboxylic acid, 7-(3,5-difluoro-2-pyridinyl)-3,4,6,7-tetrahydro-2-methyl-10-[(methylsulfonyl)methyl]-3-oxo-;8-(3,5-difluoropyridin-2-yl)-15-methyl-4-(methylsulfonylmethyl)-14-oxo-8,12,15-triazatetracyclo[8.6.1.02,7.013,17]heptadeca-1(16),2(7),3,5,10,13(17)-hexaene-5-carboxylic acid;PROTAC BRD4 ligand 1,PROTAC BRD4 ligand1,PROTAC BRD-4 ligand-1;7-(3,5-difluoropyridin-2-yl)-2-methyl-10-((methylsulfonyl)methyl)-3-oxo-3,4,6,7-tetrahydro-2H-2,4,7-triazadibenzo[cd,f]azulene-9-carboxylic acid;8-(3,5-difluoropyridin-2-yl)-4-(methanesulfonylmethyl)-15-methyl-14-oxo-8,12,15-triazatetracyclo[8.6.1.02,?.013,1?]heptadeca-1(16),2(7),3,5,10,13(17)-hexaene-5-carboxylic acid;7-(3,5-Difluoro-2-pyridyl)-2-methyl-10-[(methylsulfonyl)methyl]-3-oxo-3,4,6,7-tetrahydro-2H-pyrido[3',4':6,7]azepino[3,4,5-cd]isoindole-9-carboxylic Acid | | CAS: | 2313230-51-0 | | MF: | C23H18F2N4O5S | | MW: | 500.47 | | EINECS: | | | Product Categories: | | | Mol File: | 2313230-51-0.mol |  |
| | PROTAC BRD4 ligand-1 Chemical Properties |
| Boiling point | 874.1±65.0 °C(Predicted) | | density | 1.68±0.1 g/cm3(Predicted) | | storage temp. | Store at -20°C | | solubility | DMSO: 5 mg/mL (9.99 mM) | | form | Solid | | pka | 3.28±0.20(Predicted) | | color | Light yellow to yellow | | InChIKey | BSYGSSMAXOMCQE-UHFFFAOYSA-N | | SMILES | C1=C2C3C(=CN(C)C(=O)C=3N1)C1=CC(CS(C)(=O)=O)=C(C(O)=O)C=C1N(C1=NC=C(F)C=C1F)C2 |
| | PROTAC BRD4 ligand-1 Usage And Synthesis |
| Uses | PROTAC BRD4 ligand-1 is a potent BET inhibitor and a ligand for target BRD4 protein for PROTACT GNE-987 (HY-129937A)[1]. | | References | [1] Pillow TH, et al. Antibody Conjugation of a Chimeric BET Degrader Enables in vivo Activity. ChemMedChem. 2019 Oct 31. DOI:10.1002/cmdc.201900497 |
| | PROTAC BRD4 ligand-1 Preparation Products And Raw materials |
|